Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:42:43 UTC
Update Date2025-10-07 16:06:59 UTC
Metabolite IDMMDBc0019681
Metabolite Identification
Common NameAspernolide B
DescriptionAspernolide B is a butenolide, a class of chemical compounds characterized by a five-membered lactone ring containing a double bond. This metabolite is derived from the fungus Aspergillus terreus and has been isolated alongside other butenolides and compounds in various studies. The chemical structure of aspernolide B includes a unique arrangement of carbon, oxygen, and hydrogen atoms, contributing to its biological activity. Notably, aspernolide B has been shown to inhibit biofilm formation in certain bacterial strains without affecting their growth, indicating its potential role in disrupting microbial communities (PMID:37929585 ). Additionally, it has been identified in multiple studies involving the extraction of compounds from Aspergillus terreus, highlighting its presence in metabolic pathways associated with fungal secondary metabolism (PMID:21048353 , PMID:20823603 ). The compound's interactions within these pathways may contribute to its bioactive properties, making it a subject of interest for further research in both chemistry and microbiology.
Structure
SynonymsNot Available
Molecular FormulaC24H26O8
Average Mass442.464
Monoisotopic Mass442.162767797
IUPAC Namemethyl (2R)-4-hydroxy-2-{[4-hydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]methyl}-3-(4-hydroxyphenyl)-5-oxo-2,5-dihydrofuran-2-carboxylate
Traditional Namemethyl (2R)-4-hydroxy-2-{[4-hydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]methyl}-3-(4-hydroxyphenyl)-5-oxofuran-2-carboxylate
CAS Registry NumberNot Available
SMILES
COC(=O)[C@]1(CC2=CC(CCC(C)(C)O)=C(O)C=C2)OC(=O)C(O)=C1C1=CC=C(O)C=C1
InChI Identifier
InChI=1S/C24H26O8/c1-23(2,30)11-10-16-12-14(4-9-18(16)26)13-24(22(29)31-3)19(20(27)21(28)32-24)15-5-7-17(25)8-6-15/h4-9,12,25-27,30H,10-11,13H2,1-3H3/t24-/m1/s1
InChI KeyMJCHJLWNXODVGT-XMMPIXPASA-N