Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:45:50 UTC
Update Date2025-10-07 16:07:00 UTC
Metabolite IDMMDBc0019721
Metabolite Identification
Common NameSphingofungin B
DescriptionSphingofungin B is a sphingolipid metabolite belonging to the class of polyhydroxylated fatty acids. Its chemical structure is characterized by the presence of a 2S-amino-3R,4R,5S,14-tetrahydroxyeicos-6-enoic acid backbone, which is structurally similar to sphingosine and phytosphingosine. Sphingofungin B has been identified as a potent inhibitor of serine palmitoyltransferase (SPT), the enzyme responsible for the committed step in sphingolipid biosynthesis, leading to significant inhibition of de novo sphingolipid synthesis in cultured cells. Studies have shown that the presence of sphingofungin B, along with other inhibitors like ISP-1, can drastically reduce sphingolipid production, demonstrating its role in regulating sphingolipid metabolic pathways (PMID:10736421 ). Additionally, sphingofungin B has been utilized as an advanced synthetic intermediate in the total synthesis of various biologically active compounds, highlighting its relevance in organic synthesis (PMID:38230703 ). The synthesis of sphingofungin B itself has been accomplished through a series of chemical reactions, emphasizing its complex structure and the challenges associated with its production (PMID:25778104 ).
Structure
Synonyms
ValueSource
(2S,3R,4R,5S,6E)-2-Amino-3,4,5,14-tetrahydroxy-6-icosenoateGenerator
Molecular FormulaC20H39NO6
Average Mass389.533
Monoisotopic Mass389.27773798
IUPAC Name(2S,3R,4R,5S,6E)-2-amino-3,4,5,14-tetrahydroxyicos-6-enoic acid
Traditional Name(2S,3R,4R,5S,6E)-2-amino-3,4,5,14-tetrahydroxyicos-6-enoic acid
CAS Registry NumberNot Available
SMILES
[H]\C(CCCCCCC([H])(O)CCCCCC)=C(\[H])[C@]([H])(O)[C@@]([H])(O)[C@]([H])(O)[C@]([H])(N)C(O)=O
InChI Identifier
InChI=1S/C20H39NO6/c1-2-3-4-9-12-15(22)13-10-7-5-6-8-11-14-16(23)18(24)19(25)17(21)20(26)27/h11,14-19,22-25H,2-10,12-13,21H2,1H3,(H,26,27)/b14-11+/t15?,16-,17-,18+,19+/m0/s1
InChI KeyUAPFYKYEEDCCTL-VVJBCHSWSA-N