Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:46:40 UTC
Update Date2025-10-07 16:07:00 UTC
Metabolite IDMMDBc0019739
Metabolite Identification
Common NameMycolactone B
DescriptionMycolactone B is a polyketide, a class of compounds known for their complex structures and biological activities. Chemically, mycolactone B features a unique lactone ring and a series of aliphatic and aromatic side chains that contribute to its hydrophobic properties and interactions with cellular membranes. Notably, mycolactone B is characterized by its cytotoxic isoform, which exhibits a stronger association with the endoplasmic reticulum (ER) membrane compared to mycolactone A. This enhanced affinity is attributed to more favorable interactions with membrane lipids and water molecules, facilitating its integration into lipid bilayers (PMID:37624243 ). The compound is involved in various cellular pathways, particularly those related to membrane dynamics and cellular stress responses, highlighting its potential impact on cellular homeostasis (PMID:37292660 ). The structural features of mycolactone B not only define its chemical behavior but also its biological interactions, making it a significant subject of study in the context of polyketide research and its implications in cellular biology.
Structure
SynonymsNot Available
Molecular FormulaC44H70O9
Average Mass743.035
Monoisotopic Mass742.501983834
IUPAC Name(6S,7S,9Z,12R)-12-[(2S,4E,6R,7R,9R)-7,9-dihydroxy-4,6-dimethyldec-4-en-2-yl]-7,9-dimethyl-2-oxo-1-oxacyclododec-9-en-6-yl (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-trihydroxy-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoate
Traditional Name(6S,7S,9Z,12R)-12-[(2S,4E,6R,7R,9R)-7,9-dihydroxy-4,6-dimethyldec-4-en-2-yl]-7,9-dimethyl-2-oxo-1-oxacyclododec-9-en-6-yl (2E,4E,6E,8E,10E,12S,13S,15S)-12,13,15-trihydroxy-4,6,10-trimethylhexadeca-2,4,6,8,10-pentaenoate
CAS Registry NumberNot Available
SMILES
[H]/C(=C(/[H])\C(\C)=C(/[H])[C@]([H])(O)[C@@]([H])(O)C[C@]([H])(C)O)/C(/[H])=C(\C)/C(/[H])=C(\C)/C(/[H])=C(\[H])C(=O)O[C@@]1([H])CCCC(=O)O[C@]([H])(C\C([H])=C(C)/C[C@]1([H])C)[C@@]([H])(C)C\C(C)=C(/[H])[C@@]([H])(C)[C@]([H])(O)C[C@@]([H])(C)O
InChI Identifier
InChI=1S/C44H70O9/c1-28(13-11-14-29(2)25-39(48)40(49)27-37(10)46)21-30(3)18-20-44(51)52-41-15-12-16-43(50)53-42(19-17-31(4)22-34(41)7)35(8)24-32(5)23-33(6)38(47)26-36(9)45/h11,13-14,17-18,20-21,23,25,33-42,45-49H,12,15-16,19,22,24,26-27H2,1-10H3/b14-11+,20-18+,28-13+,29-25+,30-21+,31-17-,32-23+/t33-,34+,35+,36-,37+,38-,39+,40+,41+,42-/m1/s1
InChI KeyWKTLNJXZVDLRTJ-PCNYYULESA-N