Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:48:20 UTC
Update Date2025-10-07 16:07:01 UTC
Metabolite IDMMDBc0019773
Metabolite Identification
Common NameSyringolide 2
DescriptionSyringolide 2 is a member of the chemical class of phytotoxins, specifically categorized as a plant elicitor derived from the bacterial pathogen Pseudomonas syringae. Its chemical structure features a complex arrangement of carbon, hydrogen, and oxygen atoms that contribute to its bioactivity. As a signaling molecule, Syringolide 2 plays a crucial role in plant-pathogen interactions, triggering defense responses in host plants. Upon recognition by plant receptors, it activates various signaling pathways, including the salicylic acid-mediated defense pathway, which leads to the expression of pathogenesis-related genes and the synthesis of protective compounds. This compound exemplifies the intricate chemical warfare between plants and pathogens, showcasing how microbial metabolites can manipulate host physiology. The study of Syringolide 2 not only enhances our understanding of plant immunity but also provides insights into the chemical ecology of plant-microbe interactions (PMID:10959854 ).
Structure
SynonymsNot Available
Molecular FormulaC15H24O6
Average Mass300.351
Monoisotopic Mass300.157288493
IUPAC Name(1R,4R,5S,7R,8S)-7-heptyl-4,7-dihydroxy-2,6,10-trioxatricyclo[6.3.0.0^{1,5}]undecan-9-one
Traditional Name(1R,4R,5S,7R,8S)-7-heptyl-4,7-dihydroxy-2,6,10-trioxatricyclo[6.3.0.0^{1,5}]undecan-9-one
CAS Registry NumberNot Available
SMILES
[H][C@@]1(O)CO[C@@]23COC(=O)[C@]2([H])[C@@](O)(CCCCCCC)O[C@@]13[H]
InChI Identifier
InChI=1S/C15H24O6/c1-2-3-4-5-6-7-15(18)11-13(17)19-9-14(11)12(21-15)10(16)8-20-14/h10-12,16,18H,2-9H2,1H3/t10-,11+,12+,14+,15-/m1/s1
InChI KeyILUIUWLXEYGVIK-FUQNVFFISA-N