Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:54:54 UTC
Update Date2025-10-07 16:07:02 UTC
Metabolite IDMMDBc0019897
Metabolite Identification
Common NamePetasol
DescriptionPetasol is a sesquiterpene, a class of terpenoids comprising three isoprene units. Its chemical structure features a distinctive framework typical of eremophilane-type sesquiterpenes, characterized by a complex arrangement of carbon atoms that includes multiple rings and functional groups. Petasol has been isolated from various natural sources, including fungi such as Penicillium sp., where it was identified alongside other sesquiterpenes (PMID:29066796 ). The compound has demonstrated pharmacological activity, particularly in the form of the petasol butenoate complex (Ze 339), which has been shown to relieve allergic rhinitis-induced nasal obstruction more effectively than conventional antihistamines (PMID:21489609 ). Additionally, studies indicate that petasol and its analogs, such as isopetasin, are influenced by specific structural features, including the presence of a double bond at the C11-C12 position and an angeloyl ester moiety, which are crucial for their biological activity (PMID:35051554 ). Overall, petasol's unique chemical properties and its involvement in various biochemical pathways underscore its potential significance in pharmacology and natural product chemistry.
Structure
SynonymsNot Available
Molecular FormulaC15H22O2
Average Mass234.339
Monoisotopic Mass234.161979948
IUPAC Name(3R,4aR,5R)-6-hydroxy-4a,5-dimethyl-3-(prop-1-en-2-yl)-2,3,4,4a,5,6,7,8-octahydronaphthalen-2-one
Traditional Name(3R,4aR,5R)-6-hydroxy-4a,5-dimethyl-3-(prop-1-en-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one
CAS Registry NumberNot Available
SMILES
[H]C1(O)CCC2=CC(=O)[C@]([H])(C[C@]2(C)[C@@]1([H])C)C(C)=C
InChI Identifier
InChI=1S/C15H22O2/c1-9(2)12-8-15(4)10(3)13(16)6-5-11(15)7-14(12)17/h7,10,12-13,16H,1,5-6,8H2,2-4H3/t10-,12+,13?,15+/m0/s1
InChI KeyAJFPOVBARCSOLH-CIAJSWIGSA-N