Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 09:56:58 UTC
Update Date2025-10-07 16:07:02 UTC
Metabolite IDMMDBc0019941
Metabolite Identification
Common NameBenzomalvin B
DescriptionBenzomalvin B is a member of the chemical class of metabolites known as alkaloids. Its chemical structure has been characterized through advanced techniques such as 2-D NMR and single crystal X-ray diffraction (XRD), confirming the configuration of the compound as (E)-benzomalvin B (PMID:38349752 ). This compound is synthesized from its precursor, (±) benzomalvin E, highlighting the complexity of its biosynthetic pathways. Benzomalvin B may play a role in various metabolic processes, although specific biological pathways involving this metabolite require further exploration. The intricate synthesis and structural validation of benzomalvin B underline its potential significance in metabolic studies and its relevance in the field of natural product chemistry (PMID:38349752 ).
Structure
SynonymsNot Available
Molecular FormulaC24H17N3O2
Average Mass379.419
Monoisotopic Mass379.132076799
IUPAC Name(10E)-9-methyl-10-(phenylmethylidene)-1,9,12-triazatetracyclo[9.8.0.0^{2,7}.0^{13,18}]nonadeca-2,4,6,11,13,15,17-heptaene-8,19-dione
Traditional Name(10E)-9-methyl-10-(phenylmethylidene)-1,9,12-triazatetracyclo[9.8.0.0^{2,7}.0^{13,18}]nonadeca-2,4,6,11,13,15,17-heptaene-8,19-dione
CAS Registry NumberNot Available
SMILES
[H]\C(C1=CC=CC=C1)=C1/N(C)C(=O)C2=CC=CC=C2N2C(=O)C3=CC=CC=C3N=C12
InChI Identifier
InChI=1S/C24H17N3O2/c1-26-21(15-16-9-3-2-4-10-16)22-25-19-13-7-5-11-17(19)24(29)27(22)20-14-8-6-12-18(20)23(26)28/h2-15H,1H3/b21-15+
InChI KeyHXDZMNFJQNZXKW-RCCKNPSSSA-N