Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 10:07:52 UTC
Update Date2025-10-07 16:07:04 UTC
Metabolite IDMMDBc0020179
Metabolite Identification
Common NameAK-toxin II
DescriptionAK-toxin II is a polyketide, a class of natural products characterized by their complex structures formed through the polymerization of acetyl and other acyl units. The chemical structure of AK-toxin II features a polycyclic framework, which is typical of polyketides, and includes various functional groups that contribute to its biological activity. In terms of its chemical pathways, AK-toxin II is involved in several biosynthetic processes, including the assembly of its core structure through polyketide synthases, which catalyze the condensation of malonyl-CoA and other precursors. The total synthesis of esters of AK-toxin II, as reported in the literature, highlights the intricate chemistry associated with its synthesis, starting from vitamin C as a chiral material (PMID:3664857 ). This underscores the complexity and the synthetic challenges posed by its structure, reflecting the broader significance of polyketides in natural product chemistry and their potential applications in pharmacology and biotechnology.
Structure
Synonyms
ValueSource
(2E,4E,6E)-8-({2-[(1-hydroxyethylidene)amino]-3-phenylpropanoyl}oxy)-8-(2-methyloxiran-2-yl)octa-2,4,6-trienoateGenerator
Molecular FormulaC22H25NO6
Average Mass399.443
Monoisotopic Mass399.168187529
IUPAC Name(2E,4E,6E)-8-({2-[(1-hydroxyethylidene)amino]-3-phenylpropanoyl}oxy)-8-(2-methyloxiran-2-yl)octa-2,4,6-trienoic acid
Traditional Name(2E,4E,6E)-8-({2-[(1-hydroxyethylidene)amino]-3-phenylpropanoyl}oxy)-8-(2-methyloxiran-2-yl)octa-2,4,6-trienoic acid
CAS Registry NumberNot Available
SMILES
[H]\C(C(OC(=O)C(CC1=CC=CC=C1)N=C(C)O)C1(C)CO1)=C(\[H])/C(/[H])=C(\[H])/C(/[H])=C(\[H])C(O)=O
InChI Identifier
InChI=1S/C22H25NO6/c1-16(24)23-18(14-17-10-6-5-7-11-17)21(27)29-19(22(2)15-28-22)12-8-3-4-9-13-20(25)26/h3-13,18-19H,14-15H2,1-2H3,(H,23,24)(H,25,26)/b4-3+,12-8+,13-9+
InChI KeyUKDOGRQIIQQZBO-JKUFBBORSA-N