Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 10:12:22 UTC
Update Date2025-10-07 16:07:04 UTC
Metabolite IDMMDBc0020230
Metabolite Identification
Common NameNotoamide S
DescriptionNotoamide S is a bicyclic compound belonging to the class of alkaloids. Its chemical structure features a bicyclo[2.2.2]diazaoctane core, which is formed through a putative intramolecular hetero-Diels-Alder cycloaddition, indicating its complex synthetic pathway. Notoamide S is hypothesized to serve as a crucial biosynthetic intermediate in the production of various metabolites such as stephacidin A, notoamide B, and versicolamide B, particularly in the fungus Aspergillus sp. The compound is derived from the coupling of N-Fmoc proline with a 6-hydroxy-7-prenyl-2-reverse prenyl tryptophan derivative, synthesized via a late-stage Claisen rearrangement from a 6-propargyl-2-reverse prenylated indole (PMID:21796227 ). Additionally, distinct enantiomers of stephacidin A and 6-epi-stephacidin A may originate from notoamide S, highlighting its role as a precursor in the biosynthetic pathways of these compounds (PMID:29632911 ). The isolation and characterization of notoamide S have provided insights into its biogenetic implications, emphasizing its importance in fungal secondary metabolism (PMID:25615822 ).
Structure
SynonymsNot Available
Molecular FormulaC26H33N3O3
Average Mass435.568
Monoisotopic Mass435.252191935
IUPAC Name(3S,8aS)-1-hydroxy-3-{[6-hydroxy-7-(3-methylbut-2-en-1-yl)-2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl}-3H,4H,6H,7H,8H,8aH-pyrrolo[1,2-a]pyrazin-4-one
Traditional Name(3S,8aS)-1-hydroxy-3-{[6-hydroxy-7-(3-methylbut-2-en-1-yl)-2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl}-3H,6H,7H,8H,8aH-pyrrolo[1,2-a]pyrazin-4-one
CAS Registry NumberNot Available
SMILES
[H][C@@]12CCCN1C(=O)[C@]([H])(CC1=C(NC3=C1C=CC(O)=C3CC=C(C)C)C(C)(C)C=C)N=C2O
InChI Identifier
InChI=1S/C26H33N3O3/c1-6-26(4,5)23-18(14-19-25(32)29-13-7-8-20(29)24(31)27-19)16-11-12-21(30)17(22(16)28-23)10-9-15(2)3/h6,9,11-12,19-20,28,30H,1,7-8,10,13-14H2,2-5H3,(H,27,31)/t19-,20-/m0/s1
InChI KeyZGWIWQJHQKPWGB-PMACEKPBSA-N