Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 10:18:26 UTC
Update Date2025-10-07 16:07:04 UTC
Metabolite IDMMDBc0020316
Metabolite Identification
Common NameBikaverin
DescriptionBikaverin is a red-colored polyketide pigment produced by several Fusarium species, belonging to the chemical class of polyketides. Its chemical structure is characterized by a complex arrangement of carbon chains and functional groups typical of polyketides, which are synthesized through the action of polyketide synthases. Bikaverin is involved in various biochemical pathways, notably competing with gibberellin (GA3) biosynthesis for acetyl-CoA, as demonstrated by the deletion of its biosynthesis gene clusters using the CRISPR/Cas9 system in Fusarium fujikuroi (PMID:40480611 ). Additionally, bikaverin plays a role in the pathogenicity of Fusarium oxysporum by influencing the rhizosphere microbiome, although it does not directly damage host tissues (PMID:40301992 ). Its production is tightly regulated by environmental factors such as acidic pH and nitrogen availability, and it can be induced by co-culture with certain microbes, which upregulates the key biosynthetic gene FocBik1 (PMID:40301992 ). Overall, bikaverin exemplifies the intricate interplay between microbial metabolites and their ecological and biochemical contexts.
Structure
SynonymsNot Available
Molecular FormulaC20H14O8
Average Mass382.324
Monoisotopic Mass382.068867411
IUPAC Name7,10-dihydroxy-3,8-dimethoxy-1-methyl-11,12-dihydro-6H-5-oxatetracene-6,11,12-trione
Traditional Name7,10-dihydroxy-3,8-dimethoxy-1-methyl-5-oxatetracene-6,11,12-trione
CAS Registry NumberNot Available
SMILES
COC1=CC(C)=C2C(=O)C3=C(OC2=C1)C(=O)C1=C(O)C(OC)=CC(O)=C1C3=O
InChI Identifier
InChI=1S/C20H14O8/c1-7-4-8(26-2)5-10-12(7)17(23)15-18(24)13-9(21)6-11(27-3)16(22)14(13)19(25)20(15)28-10/h4-6,21-22H,1-3H3
InChI KeyQXNACSREWQXWCV-UHFFFAOYSA-N