Xenobiotic
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 10:22:24 UTC
Update Date2025-10-07 16:04:17 UTC
Metabolite IDMMDBc0020367
Metabolite Identification
Common NameBisdethiobis(methylthio)gliotoxin
DescriptionBisdethiobis(methylthio)gliotoxin is a diketopiperazine derivative, classified within the broader chemical class of secondary metabolites produced by fungi. Its chemical structure features a bisdethiobis(methylthio) modification of gliotoxin, indicating the presence of methylthio groups and a unique arrangement of carbon and nitrogen atoms characteristic of diketopiperazines. The biosynthesis of bisdethiobis(methylthio)gliotoxin (BmGT) involves the enzyme GtmA, which converts the precursor compound DTG into BmGT, utilizing S-adenosylmethionine (SAM) as a methyl donor, while the resultant S-adenosylhomocysteine (SAH) is recycled back to SAM through the Methyl/Met cycle (PMID:31921039 ). In fungal cultures, BmGT can be detected alongside other diketoperazines, confirming its production via high-performance liquid chromatography (PMID:35448592 ). Interestingly, certain fungal strains, such as the fumigatus ΔgliA strain, can efflux BmGT despite being deficient in gliotoxin secretion (PMID:26150413 ). Additionally, BmGT has been isolated from marine-derived fungi, highlighting its diverse ecological presence (PMID:16830893 ). The exact biological functions and pathways involving BmGT remain to be fully elucidated, with some studies suggesting its formation may involve cryptic enzymatic activity (PMID:25126990 ).
Structure
SynonymsNot Available
Molecular FormulaC15H20N2O4S2
Average Mass356.46
Monoisotopic Mass356.08644948
IUPAC Name(3R,5aS,6S,10aR)-6-hydroxy-3-(hydroxymethyl)-2-methyl-3,10a-bis(methylsulfanyl)-1H,2H,3H,4H,5aH,6H,10H,10aH-pyrazino[1,2-a]indole-1,4-dione
Traditional Name(3R,5aS,6S,10aR)-6-hydroxy-3-(hydroxymethyl)-2-methyl-3,10a-bis(methylsulfanyl)-5aH,6H,10H-pyrazino[1,2-a]indole-1,4-dione
CAS Registry NumberNot Available
SMILES
[H][C@]12N3C(=O)[C@@](CO)(SC)N(C)C(=O)[C@@]3(CC1=CC=C[C@]2([H])O)SC
InChI Identifier
InChI=1S/C15H20N2O4S2/c1-16-12(20)14(22-2)7-9-5-4-6-10(19)11(9)17(14)13(21)15(16,8-18)23-3/h4-6,10-11,18-19H,7-8H2,1-3H3/t10-,11-,14+,15+/m0/s1
InChI KeyOVBAGMZLGLXSBN-UOVKNHIHSA-N