Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 10:42:33 UTC
Update Date2025-10-07 16:07:07 UTC
Metabolite IDMMDBc0020559
Metabolite Identification
Common NameSch 528647
DescriptionSch 528647 is a metabolite classified within the chemical class of antitumor antibiotics, specifically related to fumagillin. Its chemical structure features a complex arrangement of cyclic and acyclic components that contribute to its bioactivity. The compound is known to exert its effects through the inhibition of angiogenesis, primarily by targeting the methionine aminopeptidase enzyme, which plays a crucial role in the maturation of endothelial cells and the formation of new blood vessels. This mechanism of action positions Sch 528647 as a potential therapeutic agent in cancer treatment, where the suppression of tumor-induced angiogenesis is vital for limiting tumor growth and metastasis. The structural characteristics of Sch 528647, as elucidated in the literature, highlight its relevance in the development of novel anticancer therapies, drawing parallels to other known compounds in its class. The detailed exploration of its chemical properties and biological pathways underscores the significance of Sch 528647 in ongoing research aimed at improving therapeutic strategies against malignancies (PMID:11858666 ).
Structure
SynonymsNot Available
Molecular FormulaC26H34O6
Average Mass442.552
Monoisotopic Mass442.235538815
IUPAC Name(2E,4E,6E,8E)-10-{[(1R,2S,3S)-2-methoxy-3-[(2R,3R)-2-methyl-3-(3-methylbut-2-en-1-yl)oxiran-2-yl]-4-methylidenecyclohexyl]oxy}-10-oxodeca-2,4,6,8-tetraenoic acid
Traditional Name(2E,4E,6E,8E)-10-{[(1R,2S,3S)-2-methoxy-3-[(2R,3R)-2-methyl-3-(3-methylbut-2-en-1-yl)oxiran-2-yl]-4-methylidenecyclohexyl]oxy}-10-oxodeca-2,4,6,8-tetraenoic acid
CAS Registry NumberNot Available
SMILES
[H]\C(\C(\[H])=C(/[H])\C(\[H])=C(/[H])C(=O)O[C@]1([H])CCC(=C)[C@@]([H])([C@]1([H])OC)[C@@]1(C)O[C@]1([H])CC=C(C)C)=C(\[H])/C(/[H])=C(\[H])C(O)=O
InChI Identifier
InChI=1S/C26H34O6/c1-18(2)14-17-21-26(4,32-21)24-19(3)15-16-20(25(24)30-5)31-23(29)13-11-9-7-6-8-10-12-22(27)28/h6-14,20-21,24-25H,3,15-17H2,1-2,4-5H3,(H,27,28)/b8-6+,9-7+,12-10+,13-11+/t20-,21-,24+,25-,26+/m1/s1
InChI KeyOZEROECWNOAONO-JOOYSTLBSA-N