Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 11:25:41 UTC
Update Date2025-10-07 16:07:08 UTC
Metabolite IDMMDBc0021310
Metabolite Identification
Common NameFosfocytocin
DescriptionFosfocytocin is a nucleotide antibiotic belonging to the class of nucleoside derivatives. Its chemical structure has been elucidated through spectroscopic and degradation studies, revealing specific functional groups and molecular arrangements characteristic of nucleotide antibiotics. Fosfocytocin is produced by the bacteria Pseudomonas fluorescens PK-52, alongside another compound known as fosfadecin, which is derived from Pseudomonas viridiflava PK-5 (PMID:2182591 ). The biosynthetic pathways involved in the production of fosfocytocin likely include nucleotide metabolism and modification processes that are common in bacterial systems, facilitating the synthesis of complex organic molecules from simpler precursors. These pathways may involve enzymes that catalyze the phosphorylation and structural modifications necessary for the antibiotic's activity. The detailed understanding of fosfocytocin's chemical structure and its biosynthetic origins contributes to the broader knowledge of microbial secondary metabolites and their potential applications in combating antibiotic resistance (PMID:2182591 ).
Structure
SynonymsNot Available
Molecular FormulaC12H20N4O13P2
Average Mass490.255
Monoisotopic Mass490.050210716
IUPAC Name[({[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-hydroxy-4-imino-1,4-dihydropyrimidin-1-yl)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy][2-(N-hydroxyformamido)ethoxy]phosphinic acid
Traditional Name{[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-hydroxy-4-iminopyrimidin-1-yl)oxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy(2-(N-hydroxyformamido)ethoxy)phosphinic acid
CAS Registry NumberNot Available
SMILES
[H][C@]1(COP(O)(=O)OP(O)(=O)OCCN(O)C=O)O[C@@]([H])(N2C=CC(=N)N=C2O)[C@]([H])(O)[C@]1([H])O
InChI Identifier
InChI=1S/C12H20N4O13P2/c13-8-1-2-16(12(20)14-8)11-10(19)9(18)7(28-11)5-27-31(24,25)29-30(22,23)26-4-3-15(21)6-17/h1-2,6-7,9-11,18-19,21H,3-5H2,(H,22,23)(H,24,25)(H2,13,14,20)/t7-,9-,10-,11-/m1/s1
InChI KeyBWGMNVJUNKPELE-QCNRFFRDSA-N