Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 11:37:51 UTC
Update Date2025-10-07 16:07:09 UTC
Metabolite IDMMDBc0021505
Metabolite Identification
Common NameOxysporizoline
DescriptionOxysporizoline is a polycyclic quinazoline alkaloid, classified as a secondary metabolite. This compound is produced by the marine-mudflat-derived fungus Fusarium oxysporum, showcasing its unique chemical structure that consists of fused aromatic rings and a nitrogen-containing heterocycle. The presence of multiple functional groups in oxysporizoline contributes to its biological activity, particularly its antibacterial properties, which are of interest in the development of new antimicrobial agents. The biosynthetic pathways leading to oxysporizoline involve complex enzymatic reactions, including polyketide synthesis and subsequent modifications that generate its distinct polycyclic framework. Oxysporizoline's involvement in these pathways highlights the intricate relationship between fungal metabolism and the production of bioactive compounds, which may serve as a defense mechanism against microbial threats in its environment (PMID:26732255 ). Understanding the chemistry and biosynthetic routes of oxysporizoline may provide insights into its potential applications in medicine and agriculture, particularly in combating antibiotic-resistant pathogens.
Structure
Synonyms
ValueSource
2-{[(8R,16S)-1,9,17-triazahexacyclo[14.8.0.0,.0,.0,.0,]tetracosa-2,4,6,10,12,14,18,20,22-nonaen-24-yl]amino}benzoateGenerator
Molecular FormulaC28H22N4O2
Average Mass446.51
Monoisotopic Mass446.174275964
IUPAC Name2-{[(8R,16S,24R)-1,9,17-triazahexacyclo[14.8.0.0^{2,7}.0^{8,17}.0^{10,15}.0^{18,23}]tetracosa-2,4,6,10,12,14,18,20,22-nonaen-24-yl]amino}benzoic acid
Traditional Name2-[(8R,16S,24R)-1,9,17-triazahexacyclo[14.8.0.0^{2,7}.0^{8,17}.0^{10,15}.0^{18,23}]tetracosa-2,4,6,10,12,14,18,20,22-nonaen-24-ylamino]benzoic acid
CAS Registry NumberNot Available
SMILES
[H][C@@]1(NC2=CC=CC=C2C(O)=O)N2C3=CC=CC=C3[C@]3([H])NC4=CC=CC=C4[C@@]2([H])N3C2=CC=CC=C12
InChI Identifier
InChI=1S/C28H22N4O2/c33-28(34)18-10-2-6-14-22(18)30-26-20-12-4-8-16-24(20)31-25-19-11-3-7-15-23(19)32(26)27(31)17-9-1-5-13-21(17)29-25/h1-16,25-27,29-30H,(H,33,34)/t25-,26?,27+/m1/s1
InChI KeyRTBWNVRYMUXIBS-HXMJJLHYSA-N