Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 11:54:17 UTC
Update Date2025-10-07 16:07:09 UTC
Metabolite IDMMDBc0021751
Metabolite Identification
Common NameIsosecosterigmatocystin
DescriptionIsosecosterigmatocystin is a xanthone analog, a chemical class characterized by a specific polycyclic aromatic structure. Its chemical structure features a fused ring system that is typical of xanthones, which are known for their diverse biological activities. Isosecosterigmatocystin was isolated from the culture broth and mycelia extracts of the mangrove-derived endophytic fungus Aspergillus nidulans MA-143 under 0.1% ethanol stress, alongside other metabolites such as isoversicolorin C and glulisine A (PM...). This compound may play a role in various biochemical pathways, particularly those related to fungal secondary metabolism, which often involves the production of bioactive compounds. The presence of iso secosterigmatocystin in the metabolic profile of Aspergillus nidulans suggests its potential involvement in stress response mechanisms, possibly aiding the fungus in adapting to its environment. Further studies could elucidate its specific functions and interactions within the biosynthetic pathways of this organism.
Structure
SynonymsNot Available
Molecular FormulaC18H18O8
Average Mass362.334
Monoisotopic Mass362.10016754
IUPAC Name3,8-dihydroxy-1-methoxy-4-[(2S,3S)-1,3,4-trihydroxybutan-2-yl]-9H-xanthen-9-one
Traditional Name3,8-dihydroxy-1-methoxy-4-[(2S,3S)-1,3,4-trihydroxybutan-2-yl]xanthen-9-one
CAS Registry NumberNot Available
SMILES
[H][C@@](O)(CO)[C@]([H])(CO)C1=C2OC3=CC=CC(O)=C3C(=O)C2=C(OC)C=C1O
InChI Identifier
InChI=1S/C18H18O8/c1-25-13-5-10(22)14(8(6-19)11(23)7-20)18-16(13)17(24)15-9(21)3-2-4-12(15)26-18/h2-5,8,11,19-23H,6-7H2,1H3/t8-,11+/m0/s1
InChI KeyWHNAJPFARNBVDZ-GZMMTYOYSA-N