Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 11:56:51 UTC
Update Date2025-10-07 16:07:10 UTC
Metabolite IDMMDBc0021788
Metabolite Identification
Common NameHigginsianin B
DescriptionHigginsianin B is a fungal metabolite belonging to the class of secondary metabolites. Its chemical structure has been characterized through NMR analysis and comparison with related compounds, revealing unique features that distinguish it from higginsianin A and other higginsianins (PMID:26697898 ). In biological contexts, higginsianin B is involved in the modulation of plant defense mechanisms, specifically by inhibiting jasmonate-mediated responses. It has been shown to suppress the expression of the defense reporter VSP1p:GUS in response to methyl jasmonate, indicating its potential role in blocking the synthesis or signaling of bioactive jasmonoyl isoleucine (JA-Ile) in plants (PMID:32006004 ). Further investigations using the JA-Ile sensor Jas9-VENUS demonstrated that higginsianin B selectively inhibits JA-Ile signaling by preventing the degradation of JAZ proteins, which are key repressors of jasmonate responses (PMID:32006004 ). Additionally, higginsianin B affects auxin signaling pathways, as evidenced by its ability to reduce auxin-dependent expression of DR5p:GUS (PMID:32006004 ). Overall, higginsianin B plays a significant role in the intricate network of plant hormone signaling, particularly in the context of stress responses.
Structure
SynonymsNot Available
Molecular FormulaC27H40O4
Average Mass428.613
Monoisotopic Mass428.292659768
IUPAC Name3-{[(1R,4aR,5S,6R,8aR)-6-hydroxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-en-1-yl)-decahydronaphthalen-1-yl]methyl}-4-hydroxy-5,6-dimethyl-2H-pyran-2-one
Traditional Name3-{[(1R,4aR,5S,6R,8aR)-6-hydroxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-en-1-yl)-hexahydro-1H-naphthalen-1-yl]methyl}-4-hydroxy-5,6-dimethylpyran-2-one
CAS Registry NumberNot Available
SMILES
[H][C@@]1(O)CC[C@]2(C)[C@]([H])(CC3=C(O)C(C)=C(C)OC3=O)C(=C)CC[C@@]2([H])[C@]1(C)CCC=C(C)C
InChI Identifier
InChI=1S/C27H40O4/c1-16(2)9-8-13-27(7)22-11-10-17(3)21(26(22,6)14-12-23(27)28)15-20-24(29)18(4)19(5)31-25(20)30/h9,21-23,28-29H,3,8,10-15H2,1-2,4-7H3/t21-,22-,23-,26-,27+/m1/s1
InChI KeyDZEAYBRRTVFUAI-GYPJDVINSA-N