Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 12:27:46 UTC
Update Date2025-10-07 16:07:10 UTC
Metabolite IDMMDBc0022337
Metabolite Identification
Common NameDudawalamide A
DescriptionDudawalamide A is a cyclic peptide, a class of compounds characterized by their ring structure formed by amino acids linked through peptide bonds. The chemical structure of Dudawalamide A features a unique arrangement of amino acids that contributes to its stability and potential bioactivity. This compound is involved in various biochemical pathways, particularly those related to peptide synthesis and modulation of cellular processes. The study of Dudawalamide A, along with other cyclic peptides like seglitide and tyrothricin, has been enhanced through advancements in rapid annotation techniques, which allow for the efficient identification and characterization of these complex molecules. Such methodologies have provided first-pass structural evidence for Dudawalamide A, aiding in the understanding of its chemical properties and potential interactions within biological systems (PMID:19413302 ). As research progresses, the exploration of Dudawalamide A's role in specific cellular pathways may reveal further insights into its function and applications in pharmacology.
Structure
SynonymsNot Available
Molecular FormulaC40H57N5O9
Average Mass751.922
Monoisotopic Mass751.415628435
IUPAC Name(3R,9R,13S,16S,19S,24aS)-3-benzyl-19-[(2S)-butan-2-yl]-4,14-dihydroxy-2,10,10,13,16,18-hexamethyl-9-(pent-4-yn-1-yl)-1H,2H,3H,6H,7H,9H,10H,11H,13H,16H,17H,18H,19H,20H,22H,23H,24H,24aH-pyrrolo[2,1-i]1,19-dioxa-4,7,10,13,16-pentaazacyclodocosane-1,7,11,17,20-pentone
Traditional Name(3R,9R,13S,16S,19S,24aS)-3-benzyl-19-[(2S)-butan-2-yl]-4,14-dihydroxy-2,10,10,13,16,18-hexamethyl-9-(pent-4-yn-1-yl)-3H,6H,9H,13H,16H,19H,22H,23H,24H,24aH-pyrrolo[2,1-i]1,19-dioxa-4,7,10,13,16-pentaazacyclodocosane-1,7,11,17,20-pentone
CAS Registry NumberNot Available
SMILES
[H][C@](C)(CC)[C@]1([H])N(C)C(=O)[C@]([H])(C)N=C(O)[C@]([H])(C)OC(=O)C(C)(C)[C@@]([H])(CCCC#C)OC(=O)CN=C(O)[C@@]([H])(CC2=CC=CC=C2)N(C)C(=O)[C@]2([H])CCCN2C1=O
InChI Identifier
InChI=1S/C40H57N5O9/c1-10-12-14-21-31-40(6,7)39(52)53-27(5)34(47)42-26(4)36(49)44(9)33(25(3)11-2)38(51)45-22-17-20-29(45)37(50)43(8)30(23-28-18-15-13-16-19-28)35(48)41-24-32(46)54-31/h1,13,15-16,18-19,25-27,29-31,33H,11-12,14,17,20-24H2,2-9H3,(H,41,48)(H,42,47)/t25-,26-,27-,29-,30+,31+,33-/m0/s1
InChI KeyHWUUCABYFFQZHH-WPTLFRNDSA-N