Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 12:35:13 UTC
Update Date2025-10-07 16:07:11 UTC
Metabolite IDMMDBc0022468
Metabolite Identification
Common NameNicrophorusamide A
DescriptionNicrophorusamide A is a member of the class of natural products known as amides. Its chemical structure features a unique arrangement of functional groups that contribute to its bioactivity, specifically its antibacterial properties against several Gram-positive bacteria (PMID:29112406 ). The compound has been synthesized through various methods, including the asymmetric synthesis of Fmoc-threo-HOAsn, which plays a crucial role in its total synthesis (PMID:40126535 ). Additionally, the application of the Passerini reaction product Fmoc-protected HOAsn has facilitated the development of Fmoc-solid phase peptide synthesis (Fmoc-SPPS) towards nicrophorusamide A and its analogues, enabling systematic structure-activity relationship (SAR) studies (PMID:40126535 ). The total synthesis of nicrophorusamide A has also led to a structural disproof of the proposed Noursamycin A, highlighting the importance of accurate structural elucidation in the field of natural product chemistry (PMID:37959861 ). Overall, nicrophorusamide A exemplifies the intricate interplay between synthetic chemistry and biological activity, paving the way for further exploration of its potential applications.
Structure
SynonymsNot Available
Molecular FormulaC37H56ClN9O8
Average Mass790.36
Monoisotopic Mass789.3940375
IUPAC Name(2R)-2-[(2R,5S,8R,11R,14S,17S)-17-(3-aminopropyl)-14-[(2R)-butan-2-yl]-5-[(5-chloro-1H-indol-3-yl)methyl]-3,6,9,12,15,18-hexahydroxy-11-(2-methylpropyl)-8-(propan-2-yl)-1,4,7,10,13,16-hexaazacyclooctadeca-1(18),3,6,9,12,15-hexaen-2-yl]-2-hydroxyethanimidic acid
Traditional Name(2R)-2-[(2R,5S,8R,11R,14S,17S)-17-(3-aminopropyl)-14-[(2R)-butan-2-yl]-5-[(5-chloro-1H-indol-3-yl)methyl]-3,6,9,12,15,18-hexahydroxy-8-isopropyl-11-(2-methylpropyl)-1,4,7,10,13,16-hexaazacyclooctadeca-1(18),3,6,9,12,15-hexaen-2-yl]-2-hydroxyethanimidic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](C)(CC)[C@]1([H])N=C(O)[C@@]([H])(CC(C)C)N=C(O)[C@]([H])(N=C(O)[C@]([H])(CC2=CNC3=C2C=C(Cl)C=C3)N=C(O)[C@]([H])(N=C(O)[C@]([H])(CCCN)N=C1O)[C@@]([H])(O)C(O)=N)C(C)C
InChI Identifier
InChI=1S/C37H56ClN9O8/c1-7-19(6)28-36(54)42-24(9-8-12-39)32(50)47-29(30(48)31(40)49)37(55)44-26(14-20-16-41-23-11-10-21(38)15-22(20)23)34(52)45-27(18(4)5)35(53)43-25(13-17(2)3)33(51)46-28/h10-11,15-19,24-30,41,48H,7-9,12-14,39H2,1-6H3,(H2,40,49)(H,42,54)(H,43,53)(H,44,55)(H,45,52)(H,46,51)(H,47,50)/t19-,24+,25-,26+,27-,28+,29-,30-/m1/s1
InChI KeyCUXAULQHGRSWLF-BSCGVUNJSA-N