Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 12:48:37 UTC
Update Date2025-10-07 16:07:12 UTC
Metabolite IDMMDBc0022738
Metabolite Identification
Common NameAsperterpene J
DescriptionAsperterpene J is a meroterpenoid, a chemical class that combines terpenoid and non-terpenoid components, specifically derived from fungal metabolites. Its chemical structure features a unique arrangement that contributes to its classification within this diverse group of compounds. Asperterpene J was isolated from the soil-derived fungus Aspergillus versicolor QC812, alongside other metabolites such as aspersteroline A and asperterpene O (PMID:40398505 ). In terms of biological pathways, meroterpenoids like asperterpene J are often implicated in various biosynthetic processes, potentially influencing secondary metabolite production in fungi. These compounds may play roles in ecological interactions, such as competition and defense mechanisms against microbial pathogens, although specific pathways involving asperterpene J remain to be fully elucidated. The structural complexity and biosynthetic origins of asperterpene J highlight the intricate chemistry that underpins its formation and potential biological activities.
Structure
SynonymsNot Available
Molecular FormulaC27H38O9
Average Mass506.592
Monoisotopic Mass506.251582804
IUPAC Namemethyl (1R,2S,4aS,4bS,8aR,10S,10aS)-10-hydroxy-2-[(2S)-2-hydroxy-3-methoxy-2-methyl-3-oxopropanoyl]-2,4b,8,8,10a-pentamethyl-3-methylidene-7,9-dioxo-tetradecahydrophenanthrene-1-carboxylate
Traditional Namemethyl (1R,2S,4aS,4bS,8aR,10S,10aS)-10-hydroxy-2-[(2S)-2-hydroxy-3-methoxy-2-methyl-3-oxopropanoyl]-2,4b,8,8,10a-pentamethyl-3-methylidene-7,9-dioxo-hexahydro-1H-phenanthrene-1-carboxylate
CAS Registry NumberNot Available
SMILES
[H][C@@]1(O)C(=O)[C@@]2([H])C(C)(C)C(=O)CC[C@@]2(C)[C@]2([H])CC(=C)[C@@](C)(C(=O)[C@](C)(O)C(=O)OC)[C@]([H])(C(=O)OC)[C@@]12C
InChI Identifier
InChI=1S/C27H38O9/c1-13-12-14-24(4)11-10-15(28)23(2,3)17(24)16(29)19(30)26(14,6)18(20(31)35-8)25(13,5)21(32)27(7,34)22(33)36-9/h14,17-19,30,34H,1,10-12H2,2-9H3/t14-,17-,18-,19+,24-,25+,26-,27-/m0/s1
InChI KeyQKXFADNZXOBAQQ-KVFBYCLNSA-N