Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 12:51:23 UTC
Update Date2025-10-07 16:07:12 UTC
Metabolite IDMMDBc0022795
Metabolite Identification
Common NameGramillin A
DescriptionGramillin A is a cyclic lipopeptide belonging to the class of nonribosomal peptides. Its chemical structure features a bicyclic arrangement, which is characteristic of lipopeptides, contributing to its unique properties and biological activities. Gramillin A is biosynthetically produced by the fungus Fusarium graminearum through a nonribosomal peptide synthetase (NRPS) pathway, specifically identified as the end product of NRPS8 (PMID:30395461 ). The presence of such cyclic lipopeptides in fungi suggests potential roles in ecological interactions, such as competition with other microorganisms or plant pathogens. Additionally, the structural complexity of Gramillin A may influence its interactions with biological membranes or proteins, potentially affecting various cellular pathways. The identification of Gramillin A and its analog Gramillin B highlights the diverse chemical arsenal produced by fungi, which can have implications for both natural product chemistry and the development of novel therapeutic agents (PMID:30395461 ).
Structure
SynonymsNot Available
Molecular FormulaC35H58N8O12S2
Average Mass847.01
Monoisotopic Mass846.361561688
IUPAC Name3-[(1R,4S,7S,10S,13S,16S,22R)-16-amino-3,6,9,12,15,27-hexahydroxy-10-(hydroxymethyl)-13-(2-methylpropyl)-4-octyl-19,21-dioxo-20-oxa-24,25-dithia-2,5,8,11,14,28-hexaazabicyclo[20.4.2]octacosa-2,5,8,11,14,27-hexaen-7-yl]-2-hydroxypropanimidic acid
Traditional Name3-[(1R,4S,7S,10S,13S,16S,22R)-16-amino-3,6,9,12,15,27-hexahydroxy-10-(hydroxymethyl)-13-(2-methylpropyl)-4-octyl-19,21-dioxo-20-oxa-24,25-dithia-2,5,8,11,14,28-hexaazabicyclo[20.4.2]octacosa-2,5,8,11,14,27-hexaen-7-yl]-2-hydroxypropanimidic acid
CAS Registry NumberNot Available
SMILES
[H]C(O)(C[C@]1([H])N=C(O)[C@]([H])(CO)N=C(O)[C@]([H])(CC(C)C)N=C(O)[C@@]([H])(N)CCC(=O)OC(=O)[C@]2([H])CSSC[C@]([H])(N=C(O)[C@]([H])(CCCCCCCC)N=C1O)C(O)=N2)C(O)=N
InChI Identifier
InChI=1S/C35H58N8O12S2/c1-4-5-6-7-8-9-10-20-30(49)42-24-16-56-57-17-25(43-34(24)53)35(54)55-27(46)12-11-19(36)29(48)39-21(13-18(2)3)31(50)41-23(15-44)33(52)40-22(32(51)38-20)14-26(45)28(37)47/h18-26,44-45H,4-17,36H2,1-3H3,(H2,37,47)(H,38,51)(H,39,48)(H,40,52)(H,41,50)(H,42,49)(H,43,53)/t19-,20-,21-,22-,23-,24-,25-,26?/m0/s1
InChI KeyCZXJCEODNNZLBX-BYBKDHMRSA-N