Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 13:14:00 UTC
Update Date2025-10-07 16:07:18 UTC
Metabolite IDMMDBc0023206
Metabolite Identification
Common Name6-O-acetylmalyngamide 2
Description6-O-acetylmalyngamide 2 is a member of the malyngamide chemical class, which consists of secondary metabolites produced by marine cyanobacteria. Its chemical structure features an acetyl group at the 6-O position of the malyngamide backbone, contributing to its unique properties. This compound was isolated from the marine cyanobacterium Moorea producens, alongside other malyngamide derivatives, highlighting its role in the complex metabolic pathways of these organisms. Malyngamides, including 6-O-acetylmalyngamide 2, are thought to play a role in ecological interactions, potentially serving as chemical defenses against predators or competitors in marine environments. The biosynthetic pathways leading to malyngamides involve polyketide synthases and non-ribosomal peptide synthetases, underscoring the intricate biochemical processes that generate such compounds. The study of 6-O-acetylmalyngamide 2 and its analogs contributes to our understanding of marine natural products and their potential applications in pharmacology and biotechnology (PMID:29186048 ).
Structure
SynonymsNot Available
Molecular FormulaC27H44ClNO7
Average Mass530.1
Monoisotopic Mass529.2806305
IUPAC Name(4E,7S)-N-[(2E)-2-[(1R,2S,3S,5S)-5-(acetyloxy)-2,3-dihydroxy-2-methyl-6-oxocyclohexyl]-3-chloroprop-2-en-1-yl]-7-methoxytetradec-4-enimidic acid
Traditional Name(4E,7S)-N-[(2E)-2-[(1R,2S,3S,5S)-5-(acetyloxy)-2,3-dihydroxy-2-methyl-6-oxocyclohexyl]-3-chloroprop-2-en-1-yl]-7-methoxytetradec-4-enimidic acid
CAS Registry NumberNot Available
SMILES
[H]C(Cl)=C(CN=C(O)CC\C([H])=C(/[H])C[C@]([H])(CCCCCCC)OC)[C@@]1([H])C(=O)[C@]([H])(C[C@]([H])(O)[C@@]1(C)O)OC(C)=O
InChI Identifier
InChI=1S/C27H44ClNO7/c1-5-6-7-8-10-13-21(35-4)14-11-9-12-15-24(32)29-18-20(17-28)25-26(33)22(36-19(2)30)16-23(31)27(25,3)34/h9,11,17,21-23,25,31,34H,5-8,10,12-16,18H2,1-4H3,(H,29,32)/b11-9+,20-17-/t21-,22-,23-,25-,27+/m0/s1
InChI KeyYOGYBVYVKDQUPM-SPVVEVPUSA-N