Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 13:14:03 UTC
Update Date2025-10-07 16:07:18 UTC
Metabolite IDMMDBc0023207
Metabolite Identification
Common NameN-demethyl-isomalyngamide I
DescriptionN-demethyl-isomalyngamide I is a secondary metabolite belonging to the class of malyngamides, which are known for their diverse chemical structures and biological activities. This compound features a complex arrangement of carbon, nitrogen, and oxygen atoms, reflecting the intricate nature of marine natural products. It was isolated from the marine cyanobacterium Moorea producens, highlighting its ecological origin and potential significance in marine chemistry (PMID:29186048 ). In terms of biochemical pathways, malyngamides, including N-demethyl-isomalyngamide I, are thought to be involved in various metabolic processes within the producing organism, potentially contributing to defense mechanisms against predators or pathogens. The unique structural attributes of N-demethyl-isomalyngamide I may also suggest interactions with biological targets, although specific pathways remain to be fully elucidated. Overall, the study of this compound and its relatives continues to provide insights into the chemical diversity of marine organisms and their potential applications in pharmacology and biotechnology.
Structure
SynonymsNot Available
Molecular FormulaC25H40ClNO5
Average Mass470.05
Monoisotopic Mass469.2595011
IUPAC Name(4E,7S)-N-[(2E)-3-chloro-2-[(1S,3R,4R,6S)-4-hydroxy-3-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]prop-2-en-1-yl]-7-methoxytetradec-4-enimidic acid
Traditional Name(4E,7S)-N-[(2E)-3-chloro-2-[(1S,3R,4R,6S)-4-hydroxy-3-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-1-yl]prop-2-en-1-yl]-7-methoxytetradec-4-enimidic acid
CAS Registry NumberNot Available
SMILES
[H]C(Cl)=C(CN=C(O)CC\C([H])=C(/[H])C[C@]([H])(CCCCCCC)OC)[C@]12O[C@@]1([H])C[C@@]([H])(O)[C@@]([H])(C)C2=O
InChI Identifier
InChI=1S/C25H40ClNO5/c1-4-5-6-7-9-12-20(31-3)13-10-8-11-14-23(29)27-17-19(16-26)25-22(32-25)15-21(28)18(2)24(25)30/h8,10,16,18,20-22,28H,4-7,9,11-15,17H2,1-3H3,(H,27,29)/b10-8+,19-16+/t18-,20+,21-,22+,25+/m1/s1
InChI KeyYWLFVPLREWALDU-YTCQMKKZSA-N