Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 13:45:30 UTC
Update Date2025-10-07 16:07:22 UTC
Metabolite IDMMDBc0023846
Metabolite Identification
Common NameTaichunamide H
DescriptionTaichunamide H is a novel indole alkaloid belonging to the chemical class of metabolites. It was isolated from the fungus Aspergillus versicolor and is structurally characterized as a derivative of the indole framework, which is common among various bioactive compounds. The chemical structure of Taichunamide H includes specific functional groups that contribute to its unique properties and potential bioactivity. In the context of biological pathways, Taichunamide H may play a role in various metabolic processes, although its specific mechanisms of action are not fully elucidated. The compound has been involved in studies that include the determination of its structure and the revision of related compounds, such as Taichunamide A, highlighting its importance in the field of natural product chemistry (PMID:29400467 ). Additionally, the initial misidentification of its structure underscores the complexity of secondary metabolites derived from fungal sources (PMID:30765898 ). Overall, Taichunamide H represents a significant addition to the repertoire of natural products with potential implications in pharmacology and biochemistry.
Structure
SynonymsNot Available
Molecular FormulaC26H29N3O4
Average Mass447.535
Monoisotopic Mass447.215806426
IUPAC Name(1S,3R,17S,19S)-3,26-dihydroxy-9,9,16,16-tetramethyl-8-oxa-14,23,25-triazaheptacyclo[17.5.2.0^{1,17}.0^{3,15}.0^{4,13}.0^{7,12}.0^{19,23}]hexacosa-4(13),5,7(12),10,14,25-hexaen-24-one
Traditional Name(1S,3R,17S,19S)-3,26-dihydroxy-9,9,16,16-tetramethyl-8-oxa-14,23,25-triazaheptacyclo[17.5.2.0^{1,17}.0^{3,15}.0^{4,13}.0^{7,12}.0^{19,23}]hexacosa-4(13),5,7(12),10,14,25-hexaen-24-one
CAS Registry NumberNot Available
SMILES
[H][C@@]12C[C@]34CCCN3C(=O)[C@@]1(C[C@@]1(O)C3=C(N=C1C2(C)C)C1=C(OC(C)(C)C=C1)C=C3)N=C4O
InChI Identifier
InChI=1S/C26H29N3O4/c1-22(2)10-8-14-16(33-22)7-6-15-18(14)27-19-23(3,4)17-12-24-9-5-11-29(24)21(31)25(17,28-20(24)30)13-26(15,19)32/h6-8,10,17,32H,5,9,11-13H2,1-4H3,(H,28,30)/t17-,24-,25-,26+/m0/s1
InChI KeyPYHKDROAWLAEDE-VKAHWXPLSA-N