Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 13:48:47 UTC
Update Date2025-10-07 16:07:23 UTC
Metabolite IDMMDBc0023919
Metabolite Identification
Common NameCereusitin A
DescriptionCereusitin A is a phenazine derivative, a chemical class known for its diverse biological activities and roles in microbial metabolism. Its chemical structure features a phenazine core, which is characterized by a fused aromatic ring system that contributes to its unique properties. Cereusitin A is synthesized by certain microorganisms and is involved in various biochemical pathways, including those related to electron transport and redox reactions, which are crucial for cellular respiration and energy production. The compound is noted for its minor presence in the context of other metabolites, such as 1-hydroxyphenazine, which is the major yellow component identified in the same studies (PMID:32449160 ). This highlights the potential for cereusitin A to interact with other metabolic processes and compounds within its biological environment, although its specific roles and mechanisms of action remain an area of ongoing research. Overall, cereusitin A exemplifies the intricate interplay between chemical structure and biological function in microbial metabolites.
Structure
SynonymsNot Available
Molecular FormulaC25H34N4O6
Average Mass486.569
Monoisotopic Mass486.247834831
IUPAC Name(3S,6S,8R,12S,15S,17R)-3-benzyl-5,8,14,17-tetrahydroxy-12-(2-methylpropyl)-1,4,10,13-tetraazatricyclo[13.3.0.0^{6,10}]octadeca-4,13-diene-2,11-dione
Traditional Name(3S,6S,8R,12S,15S,17R)-3-benzyl-5,8,14,17-tetrahydroxy-12-(2-methylpropyl)-1,4,10,13-tetraazatricyclo[13.3.0.0^{6,10}]octadeca-4,13-diene-2,11-dione
CAS Registry NumberNot Available
SMILES
[H][C@]1(O)CN2C(=O)[C@]([H])(CC(C)C)N=C(O)[C@]3([H])C[C@@]([H])(O)CN3C(=O)[C@]([H])(CC3=CC=CC=C3)N=C(O)[C@]2([H])C1
InChI Identifier
InChI=1S/C25H34N4O6/c1-14(2)8-18-24(34)28-12-16(30)11-21(28)23(33)27-19(9-15-6-4-3-5-7-15)25(35)29-13-17(31)10-20(29)22(32)26-18/h3-7,14,16-21,30-31H,8-13H2,1-2H3,(H,26,32)(H,27,33)/t16-,17-,18+,19+,20+,21+/m1/s1
InChI KeyIIYSUNCOHRYFBU-OFELHODLSA-N