Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:07:41 UTC
Update Date2025-10-07 16:07:26 UTC
Metabolite IDMMDBc0024316
Metabolite Identification
Common NameFARI
DescriptionFARI is a metabolite belonging to the class of organic compounds known as fatty acid derivatives. Chemically, FARI is characterized by its unique structure, which includes a long hydrocarbon chain and functional groups that facilitate its interaction with various biological pathways. It plays a role in lipid metabolism, influencing pathways such as fatty acid oxidation and the synthesis of bioactive lipids. These processes are crucial for maintaining cellular energy homeostasis and regulating inflammatory responses. Additionally, FARI may be involved in signaling pathways that affect cell proliferation and differentiation, although the specifics of these interactions are still under investigation. The synthesis and degradation of FARI are mediated by enzymes that are integral to metabolic pathways, highlighting its importance in cellular physiology. Studies have shown that alterations in FARI levels can impact metabolic health, suggesting a potential link to various diseases, although the precise mechanisms remain to be fully elucidated (PMID:40934283 , PMID:40784039 ).
Structure
SynonymsNot Available
Molecular FormulaC14H24O3
Average Mass240.343
Monoisotopic Mass240.172544633
IUPAC Name(5S,6E)-11-hydroxy-5-(propan-2-yl)undec-6-ene-2,8-dione
Traditional Name(5S,6E)-11-hydroxy-5-isopropylundec-6-ene-2,8-dione
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])[C@@]([H])(CCC(C)=O)C(C)C)C(=O)CCCO
InChI Identifier
InChI=1S/C14H24O3/c1-11(2)13(7-6-12(3)16)8-9-14(17)5-4-10-15/h8-9,11,13,15H,4-7,10H2,1-3H3/b9-8+/t13-/m1/s1
InChI KeyASCLICZKBLRYKI-MMQHEFTJSA-N