Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:16:54 UTC
Update Date2025-10-07 16:07:27 UTC
Metabolite IDMMDBc0024474
Metabolite Identification
Common NameYamchaetoglobosin A
DescriptionYamchaetoglobosin A is a secondary metabolite belonging to the class of cytochalasans, which are known for their diverse biological activities. Chemically, it features a complex structure characterized by a unique oxidation pattern, including a ring-opening that is crucial for its biological function. This compound was isolated from the fermentation of Chaetomium globosum in Chinese yam (Dioscorea opposita), alongside other metabolites such as aureonitol. The structural modifications in yamchaetoglobosin A, particularly the oxidation processes, are significant as they contribute to its ability to inhibit nitric oxide (NO) production and exhibit anti-tumor properties. The preliminary structure-activity relationship indicates that these chemical alterations are essential for maintaining its bioactivity, showcasing the intricate link between its chemical structure and biological effects (PMID:28927295 ). Thus, yamchaetoglobosin A represents a fascinating example of how specific chemical modifications can influence the pharmacological potential of natural products derived from fungi.
Structure
SynonymsNot Available
Molecular FormulaC33H40N2O6
Average Mass560.691
Monoisotopic Mass560.288637016
IUPAC Namemethyl 4-[(1S,3aS,4R,5S,7S,7aR)-4-[(1E,4S,5E)-4,6-dimethyl-7-oxohepta-1,5-dien-1-yl]-3,5-dihydroxy-1-[(1H-indol-3-yl)methyl]-7-methyl-6-methylidene-3a,4,5,6,7,7a-hexahydro-1H-isoindol-3a-yl]-4-oxobutanoate
Traditional Namemethyl 4-[(1S,3aS,4R,5S,7S,7aR)-4-[(1E,4S,5E)-4,6-dimethyl-7-oxohepta-1,5-dien-1-yl]-3,5-dihydroxy-1-(1H-indol-3-ylmethyl)-7-methyl-6-methylidene-4,5,7,7a-tetrahydro-1H-isoindol-3a-yl]-4-oxobutanoate
CAS Registry NumberNot Available
SMILES
[H]\C(C[C@]([H])(C)C(\[H])=C(/C)C=O)=C(\[H])[C@@]1([H])[C@]([H])(O)C(=C)[C@@]([H])(C)[C@@]2([H])[C@]([H])(CC3=CNC4=CC=CC=C34)N=C(O)[C@@]12C(=O)CCC(=O)OC
InChI Identifier
InChI=1S/C33H40N2O6/c1-19(15-20(2)18-36)9-8-11-25-31(39)22(4)21(3)30-27(16-23-17-34-26-12-7-6-10-24(23)26)35-32(40)33(25,30)28(37)13-14-29(38)41-5/h6-8,10-12,15,17-19,21,25,27,30-31,34,39H,4,9,13-14,16H2,1-3,5H3,(H,35,40)/b11-8+,20-15+/t19-,21+,25-,27-,30-,31+,33+/m0/s1
InChI KeyXVACANNIRRWPTB-YUUCEKJRSA-N