Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:28:39 UTC
Update Date2025-10-07 16:07:28 UTC
Metabolite IDMMDBc0024669
Metabolite Identification
Common NameOocydin A
DescriptionOocydin A is a chlorinated macrolide belonging to the chemical class of polyketides. Its chemical structure features a complex arrangement of carbon rings and halogen substituents, which contribute to its bioactivity. Oocydin A is produced by the rhizobacterium Serratia plymuthica, specifically strains such as 4Rx5 and A153, which are known to synthesize various bioactive secondary metabolites, including the antifungal and anti-oomycete haterumalide (PMID:30533641 ). The biosynthesis of oocydin A is mediated by a large trans-acyltransferase polyketide synthase gene cluster, with involvement from several key enzymes, including hydroxymethylglutaryl-coenzyme A synthase and flavin-dependent tailoring enzymes (PMID:25753587 ). Additionally, the regulation of its biosynthesis is influenced by quorum sensing mechanisms and the RNA chaperone Hfq (PMID:25753587 ). Oocydin A's biological pathways include its role as an antifungal and anti-oomycete agent, making it significant in the context of plant-associated bacteria (PMID:26914969 ). The compound's unique structure and biosynthetic pathways highlight its potential applications in agriculture and medicine.
Structure
SynonymsNot Available
Molecular FormulaC23H31ClO8
Average Mass470.94
Monoisotopic Mass470.1707457
IUPAC Name(3E,5S)-5-[(1S,6Z,9E,13S,15S)-5-(acetyloxy)-10-chloro-6-methyl-3-oxo-2,14-dioxabicyclo[11.2.1]hexadeca-6,9-dien-15-yl]-5-hydroxy-3-methylpent-3-enoic acid
Traditional Name(3E,5S)-5-[(1S,6Z,9E,13S,15S)-5-(acetyloxy)-10-chloro-6-methyl-3-oxo-2,14-dioxabicyclo[11.2.1]hexadeca-6,9-dien-15-yl]-5-hydroxy-3-methylpent-3-enoic acid
CAS Registry NumberNot Available
SMILES
CC(=O)OC1CC(=O)O[C@H]2C[C@H](CC\C(Cl)=C/C\C=C1\C)O[C@H]2[C@@H](O)\C=C(/C)CC(O)=O
InChI Identifier
InChI=1S/C23H31ClO8/c1-13(10-21(27)28)9-18(26)23-20-11-17(31-23)8-7-16(24)6-4-5-14(2)19(30-15(3)25)12-22(29)32-20/h5-6,9,17-20,23,26H,4,7-8,10-12H2,1-3H3,(H,27,28)/b13-9+,14-5-,16-6+/t17-,18-,19?,20-,23-/m0/s1
InChI KeyOAWOFENLLWPBEQ-AQHKLOSRSA-N