Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:28:58 UTC
Update Date2025-10-07 16:07:28 UTC
Metabolite IDMMDBc0024676
Metabolite Identification
Common NameMycobactin T
DescriptionMycobactin T is a siderophore belonging to the chemical class of mycobactins, which are complex iron-chelating compounds produced by certain mycobacterial species. The chemical structure of mycobactin T features a unique arrangement of lipid tails that can be permuted, allowing for variations in its synthesis. A modular synthesis route has been developed that facilitates this permutation, highlighting the compound's structural versatility (PMID:34699221 ). The synthesis process involves Boc-removal with HCl/EtOAc, followed by treatment of the resulting hydroxylamine with stearyl fluoride, yielding mycobactin T in a 65% yield (PMID:34699221 ). Additionally, the structure of the gallium mycobactin T-N-acetyl derivative (GaMbT-NAc) has been elucidated using 1H NMR, providing insights into its chemical properties (PMID:34699221 ). Mycobactin T plays a role in iron acquisition pathways, which are crucial for the survival and virulence of mycobacteria, enabling them to thrive in iron-limited environments.
Structure
Synonyms
ValueSource
(3R)-N-[(3S)-1-Hydroxy-2-oxoazepan-3-yl]-3-{[(2S)-2-({hydroxy[(4R)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methylidene}amino)-6-(N-hydroxyicosanamido)hexanoyl]oxy}butanimidateGenerator
Molecular FormulaC46H75N5O10
Average Mass858.131
Monoisotopic Mass857.551393635
IUPAC Name(3R)-N-[(3S)-1-hydroxy-2-oxoazepan-3-yl]-3-{[(2S)-2-({hydroxy[(4R)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methylidene}amino)-6-(N-hydroxyicosanamido)hexanoyl]oxy}butanimidic acid
Traditional Name(3R)-N-[(3S)-1-hydroxy-2-oxoazepan-3-yl]-3-{[(2S)-2-({hydroxy[(4R)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazol-4-yl]methylidene}amino)-6-(N-hydroxyicosanamido)hexanoyl]oxy}butanimidic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](C)(CC(O)=N[C@@]1([H])CCCCN(O)C1=O)OC(=O)[C@]([H])(CCCCN(O)C(=O)CCCCCCCCCCCCCCCCCCC)N=C(O)[C@@]1([H])COC(=N1)C1=CC=CC=C1O
InChI Identifier
InChI=1S/C46H75N5O10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-30-42(54)50(58)31-24-23-28-38(48-43(55)39-34-60-44(49-39)36-26-20-21-29-40(36)52)46(57)61-35(2)33-41(53)47-37-27-22-25-32-51(59)45(37)56/h20-21,26,29,35,37-39,52,58-59H,3-19,22-25,27-28,30-34H2,1-2H3,(H,47,53)(H,48,55)/t35-,37+,38+,39-/m1/s1
InChI KeyFLJNVPAGIYBTDU-VBCJCOOLSA-N