Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:31:04 UTC
Update Date2025-10-07 16:04:17 UTC
Metabolite IDMMDBc0024719
Metabolite Identification
Common NameAlpha-galactosylceramide
DescriptionAlpha-galactosylceramide is a sphingolipid, a class of lipids characterized by a backbone of sphingoid bases. Its chemical structure consists of a ceramide moiety linked to a galactose sugar, which contributes to its unique properties and biological functions. This metabolite plays a crucial role in various biological pathways, particularly in the context of immune modulation. For instance, it has been shown that the early gut symbiont Bacteroides fragilis produces a species- and stage-specific form of alpha-galactosylceramide (BfaGC), which is involved in orchestrating neonatal colonization and modulating the immune response (PMID:40654802 ). This highlights the importance of alpha-galactosylceramide in the interaction between gut microbiota and host immune systems, showcasing its potential influence on health and disease through its structural and functional characteristics.
Structure
Synonyms
ValueSource
(3R)-3-Hydroxy-N-[(2S,3R)-3-hydroxy-15-methyl-1-{[(2R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexadecan-2-yl]-15-methylhexadecanimidateGenerator
Molecular FormulaC40H79NO9
Average Mass718.07
Monoisotopic Mass717.575483128
IUPAC Name(3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-15-methyl-1-{[(2R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexadecan-2-yl]-15-methylhexadecanimidic acid
Traditional Name(3R)-3-hydroxy-N-[(2S,3R)-3-hydroxy-15-methyl-1-{[(2R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexadecan-2-yl]-15-methylhexadecanimidic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](O)(CCCCCCCCCCCC(C)C)CC(O)=N[C@@]([H])(CO[C@]1([H])OC([H])(CO)[C@]([H])(O)C([H])(O)C1([H])O)[C@]([H])(O)CCCCCCCCCCCC(C)C
InChI Identifier
InChI=1S/C40H79NO9/c1-30(2)23-19-15-11-7-5-9-13-17-21-25-32(43)27-36(45)41-33(29-49-40-39(48)38(47)37(46)35(28-42)50-40)34(44)26-22-18-14-10-6-8-12-16-20-24-31(3)4/h30-35,37-40,42-44,46-48H,5-29H2,1-4H3,(H,41,45)/t32-,33+,34-,35?,37+,38?,39?,40-/m1/s1
InChI KeyTVSWUEMHNUKUAZ-FQMLERHQSA-N