Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:33:54 UTC
Update Date2025-10-07 16:07:29 UTC
Metabolite IDMMDBc0024772
Metabolite Identification
Common NameMannonerolidol
DescriptionMannonerolidol is a novel metabolite belonging to the chemical class of nerolidol mannosides. Its chemical structure features a mannoside moiety linked to a nerolidol backbone, which is characterized by a long hydrocarbon chain and multiple double bonds. This unique configuration contributes to its potential bioactivity. Mannonerolidol was isolated from the culture broth of the fungus Schizophyllum commune, alongside other compounds such as schizostatin and nerolidol, highlighting its presence in a complex mixture of secondary metabolites (PMID:30542161 ). The compound is involved in various biochemical pathways, particularly those related to antimicrobial activity, as it was discovered during efforts to identify new antimicrobial agents derived from higher fungi (PMID:30542161 ). The structural attributes of mannonerolidol suggest that it may interact with biological membranes or microbial targets, although specific mechanisms of action remain to be fully elucidated. Overall, mannonerolidol represents an interesting subject for further research in the context of natural product chemistry and its potential applications in antimicrobial therapy.
Structure
SynonymsNot Available
Molecular FormulaC21H36O6
Average Mass384.513
Monoisotopic Mass384.251188879
IUPAC Name(2S,3R,4R,5R,6R)-2-(hydroxymethyl)-6-{[(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxy}oxane-3,4,5-triol
Traditional Name(2S,3R,4R,5R,6R)-2-(hydroxymethyl)-6-{[(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]oxy}oxane-3,4,5-triol
CAS Registry NumberNot Available
SMILES
[H][C@@]1(CO)O[C@]([H])(O[C@@](C)(CCC=C(C)CCC=C(C)C)C=C)[C@]([H])(O)[C@]([H])(O)[C@@]1([H])O
InChI Identifier
InChI=1S/C21H36O6/c1-6-21(5,12-8-11-15(4)10-7-9-14(2)3)27-20-19(25)18(24)17(23)16(13-22)26-20/h6,9,11,16-20,22-25H,1,7-8,10,12-13H2,2-5H3/t16-,17-,18+,19+,20+,21+/m0/s1
InChI KeyRFJXXUYBKKEANF-FLNLFJTMSA-N