Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:34:49 UTC
Update Date2025-10-07 16:07:29 UTC
Metabolite IDMMDBc0024791
Metabolite Identification
Common Name(2S)-2,3-dihydro-5,6-dihydroxy-2-methyl-4H-1-benzopyran-4-one
Description(2S)-2,3-dihydro-5,6-dihydroxy-2-methyl-4H-1-benzopyran-4-one is a polyketide, a class of secondary metabolites characterized by their diverse structures and biological activities. This compound features a benzopyran backbone, with hydroxyl groups at the 5 and 6 positions and a methyl group at the 2 position, contributing to its unique chemical properties. It was isolated from the culture broth of Colletotrichum gloeosporioides, an endophytic fungus associated with the mangrove plant Ceriops tagal, highlighting its ecological role in plant-fungal interactions (PMID:30932015 ). Polyketides like (2S)-2,3-dihydro-5,6-dihydroxy-2-methyl-4H-1-benzopyran-4-one are known to participate in various biosynthetic pathways, often leading to compounds with antimicrobial, antifungal, or cytotoxic activities, which can be relevant in the development of pharmaceuticals and agrochemicals. The specific pathways involving this compound may contribute to the organism's survival and adaptation in its ecological niche, as well as potential applications in biotechnology and medicine.
Structure
SynonymsNot Available
Molecular FormulaC10H10O4
Average Mass194.186
Monoisotopic Mass194.057908802
IUPAC Name(2S)-5,6-dihydroxy-2-methyl-3,4-dihydro-2H-1-benzopyran-4-one
Traditional Name(2S)-5,6-dihydroxy-2-methyl-2,3-dihydro-1-benzopyran-4-one
CAS Registry NumberNot Available
SMILES
[H][C@]1(C)CC(=O)C2=C(O1)C=CC(O)=C2O
InChI Identifier
InChI=1S/C10H10O4/c1-5-4-7(12)9-8(14-5)3-2-6(11)10(9)13/h2-3,5,11,13H,4H2,1H3/t5-/m0/s1
InChI KeyNCDYNSPDUPPSRB-YFKPBYRVSA-N