Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:34:55 UTC
Update Date2025-10-07 16:07:30 UTC
Metabolite IDMMDBc0024793
Metabolite Identification
Common Name4-ethyl-3-hydroxy-6-propenyl-2H-pyran-2-one
Description4-ethyl-3-hydroxy-6-propenyl-2H-pyran-2-one is a polyketide, a class of secondary metabolites known for their diverse biological activities and complex structures. This compound features a pyran ring with a propenyl side chain and hydroxyl groups, contributing to its chemical reactivity and potential interactions in biological systems. It has been isolated from the culture broth of Colletotrichum gloeosporioides, an endophytic fungus associated with the mangrove species Ceriops tagal, highlighting its ecological role in plant-fungal interactions (PMID:30932015 ). Polyketides like 4-ethyl-3-hydroxy-6-propenyl-2H-pyran-2-one are often involved in various biosynthetic pathways, including those related to the production of antimicrobial and antifungal agents, which may provide the host plant with a competitive advantage in its environment. The structural characteristics of this compound suggest potential bioactivity, making it a subject of interest for further research into its pharmacological properties and mechanisms of action.
Structure
SynonymsNot Available
Molecular FormulaC10H12O3
Average Mass180.203
Monoisotopic Mass180.078644246
IUPAC Name4-ethyl-3-hydroxy-6-[(1E)-prop-1-en-1-yl]-2H-pyran-2-one
Traditional Name4-ethyl-3-hydroxy-6-[(1E)-prop-1-en-1-yl]pyran-2-one
CAS Registry NumberNot Available
SMILES
[H]\C(C)=C(\[H])C1=CC(CC)=C(O)C(=O)O1
InChI Identifier
InChI=1S/C10H12O3/c1-3-5-8-6-7(4-2)9(11)10(12)13-8/h3,5-6,11H,4H2,1-2H3/b5-3+
InChI KeyMSWKQQGUQXTPPA-HWKANZROSA-N