Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:42:00 UTC
Update Date2025-10-07 16:07:30 UTC
Metabolite IDMMDBc0024911
Metabolite Identification
Common NameSclerosporide
DescriptionSclerosporide is a secondary metabolite belonging to the chemical class of terpenoids. Its chemical structure is characterized by a complex arrangement of carbon atoms typical of terpenoid compounds, which are known for their diverse biological activities. Sclerosporide is produced by specific fungal mutants, particularly the ΔcclA mutant, which exhibits an enriched secondary metabolite profile compared to the wild type. This mutant is capable of overproducing various terpenoid families, including sclerosporide, alongside other novel compounds such as colletorin D and higginsianins (PMID:30924614 ). The biosynthetic pathways involved in the production of sclerosporide likely intersect with those of other terpenoid compounds, highlighting the intricate metabolic networks that fungi utilize to generate diverse secondary metabolites. These pathways may involve enzymatic modifications and precursor utilization that contribute to the structural diversity observed within this class of compounds. Overall, sclerosporide represents a fascinating example of fungal secondary metabolism, showcasing the potential for discovering novel bioactive molecules through genetic manipulation of metabolic pathways.
Structure
SynonymsNot Available
Molecular FormulaC23H36O7
Average Mass424.534
Monoisotopic Mass424.246103499
IUPAC Name(1S,2S,3S,4R,5S,6R)-2,3,5-trihydroxy-4,6-dimethoxycyclohexyl (4S,4aR,8aS)-6-methyl-4-(propan-2-yl)-3,4,4a,7,8,8a-hexahydronaphthalene-1-carboxylate
Traditional Name(1S,2S,3S,4R,5S,6R)-2,3,5-trihydroxy-4,6-dimethoxycyclohexyl (4S,4aR,8aS)-4-isopropyl-6-methyl-3,4,4a,7,8,8a-hexahydronaphthalene-1-carboxylate
CAS Registry NumberNot Available
SMILES
[H][C@]1(CC=C(C(=O)O[C@@]2([H])[C@@]([H])(O)[C@]([H])(O)[C@@]([H])(OC)[C@]([H])(O)[C@@]2([H])OC)[C@@]2([H])CCC(C)=C[C@@]12[H])C(C)C
InChI Identifier
InChI=1S/C23H36O7/c1-11(2)13-8-9-15(14-7-6-12(3)10-16(13)14)23(27)30-22-18(25)17(24)20(28-4)19(26)21(22)29-5/h9-11,13-14,16-22,24-26H,6-8H2,1-5H3/t13-,14+,16-,17-,18-,19-,20+,21+,22-/m0/s1
InChI KeyUFNLIQIFTAMKKF-PNJRTPMQSA-N