Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 14:42:02 UTC
Update Date2025-10-07 16:07:30 UTC
Metabolite IDMMDBc0024912
Metabolite Identification
Common NameColletorin D
DescriptionColletorin D is a secondary metabolite belonging to the chemical class of polyketides. Its chemical structure is characterized by a complex arrangement of carbon atoms, typically featuring multiple functional groups that contribute to its biological activity. Colletorin D is produced by the fungal species of the genus Colletotrichum, specifically from strains isolated in Cuba and Zimbabwe, where it was identified alongside other novel metabolites. The biosynthetic pathways involving colletorin D are linked to the ΔcclA mutant, which has been shown to exclusively produce this compound along with colletorin D acid and other derivatives. Research indicates that colletorin D plays a role in the metabolic processes of these fungi, particularly in the production of diverse secondary metabolites through liquid-state fermentation and solid-phase extraction techniques. The identification of colletorin D and its analogs highlights the intricate biochemical pathways that fungi utilize to synthesize these compounds, which may have implications for understanding fungal biology and potential applications in biotechnology (PMID:35175766 , PMID:30924614 ).
Structure
SynonymsNot Available
Molecular FormulaC13H16O3
Average Mass220.268
Monoisotopic Mass220.109944375
IUPAC Name2,4-dihydroxy-6-methyl-3-(3-methylbut-2-en-1-yl)benzaldehyde
Traditional Name2,4-dihydroxy-6-methyl-3-(3-methylbut-2-en-1-yl)benzaldehyde
CAS Registry NumberNot Available
SMILES
CC(C)=CCC1=C(O)C=C(C)C(C=O)=C1O
InChI Identifier
InChI=1S/C13H16O3/c1-8(2)4-5-10-12(15)6-9(3)11(7-14)13(10)16/h4,6-7,15-16H,5H2,1-3H3
InChI KeyITDNZOGHXSEHSE-UHFFFAOYSA-N