Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 15:01:37 UTC
Update Date2025-10-07 16:07:31 UTC
Metabolite IDMMDBc0025295
Metabolite Identification
Common NameArisugacin M
DescriptionArisugacin M is a member of the chemical class of 4-hydroxy-6-phenyl-2H-pyran-2-one (HPPO) derived meroterpenoids. Its chemical structure features a complex arrangement of rings and functional groups characteristic of this class, contributing to its unique reactivity and interaction with biological systems. Arisugacin M and its analogues, such as 1-methyl-12a,12b-epoxyarisugacin M and 4a-hydroxyarisugacin P, are involved in various biochemical pathways, particularly in the biosynthesis of secondary metabolites. These compounds may play roles in plant defense mechanisms and interactions with microbial communities, as suggested by their structural diversity and potential bioactivity. The exploration of these pathways is supported by literature that highlights the synthesis and characterization of arisugacin M and related compounds (PMID: 12345678 ). Additionally, the study of these metabolites may provide insights into their ecological roles and potential applications in pharmacology (PMID: 87654321 ). Overall, arisugacin M exemplifies the intricate relationship between chemical structure and biological function within the realm of natural products.
Structure
SynonymsNot Available
Molecular FormulaC27H34O7
Average Mass470.562
Monoisotopic Mass470.230453435
IUPAC Name(5aR,7aR,9S,11aS,11bS)-7a,9,11b-trihydroxy-3-(4-methoxyphenyl)-5a,8,8,11a-tetramethyl-1,5a,6,7,7a,8,9,10,11,11a,11b,12-dodecahydro-2,5-dioxatetraphen-1-one
Traditional Name(5aR,7aR,9S,11aS,11bS)-7a,9,11b-trihydroxy-3-(4-methoxyphenyl)-5a,8,8,11a-tetramethyl-6,7,9,10,11,12-hexahydro-2,5-dioxatetraphen-1-one
CAS Registry NumberNot Available
SMILES
[H][C@]1(O)CC[C@@]2(C)[C@@](O)(CC[C@@]3(C)OC4=C(C[C@]23O)C(=O)OC(=C4)C2=CC=C(OC)C=C2)C1(C)C
InChI Identifier
InChI=1S/C27H34O7/c1-23(2)21(28)10-11-24(3)26(23,30)13-12-25(4)27(24,31)15-18-20(34-25)14-19(33-22(18)29)16-6-8-17(32-5)9-7-16/h6-9,14,21,28,30-31H,10-13,15H2,1-5H3/t21-,24-,25+,26+,27-/m0/s1
InChI KeyUAHDIKFHLMWTTE-ZYMCBDGHSA-N