Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 15:30:55 UTC
Update Date2025-10-07 16:07:34 UTC
Metabolite IDMMDBc0025795
Metabolite Identification
Common NameTerreustoxin I
DescriptionTerreustoxin I is a polyketide metabolite known for its potential as a Tankyrase inhibitor. Its chemical structure features a complex arrangement typical of polyketides, characterized by a series of carbon chains and functional groups that contribute to its biological activity. The compound has been investigated through an integrated computational workflow that includes molecular docking and molecular dynamics simulations, which suggest its ability to interact with the Tankyrase enzyme, a key player in various cellular pathways, including the regulation of Wnt signaling and telomere maintenance. Additionally, MM/PBSA analysis and Principal Component Analysis (PCA) have been employed to further elucidate its binding affinity and stability within the enzyme's active site. The exploration of Terreustoxin I's interactions highlights its potential role in modulating important biochemical pathways, making it a compound of interest for further research in therapeutic applications (PMID:39921842 ).
Structure
SynonymsNot Available
Molecular FormulaC26H30O8
Average Mass470.518
Monoisotopic Mass470.194067926
IUPAC Namemethyl (1R,2S,5S,7S,11S)-17-hydroxy-1,5,7,11,15,15-hexamethyl-8-methylidene-3,6,14,18-tetraoxo-4-oxatetracyclo[8.8.0.0^{2,7}.0^{11,16}]octadeca-9,16-diene-5-carboxylate
Traditional Namemethyl (1R,2S,5S,7S,11S)-17-hydroxy-1,5,7,11,15,15-hexamethyl-8-methylidene-3,6,14,18-tetraoxo-4-oxatetracyclo[8.8.0.0^{2,7}.0^{11,16}]octadeca-9,16-diene-5-carboxylate
CAS Registry NumberNot Available
SMILES
[H][C@]12C(=O)O[C@](C)(C(=O)OC)C(=O)[C@]1(C)C(=C)C=C1[C@]3(C)CCC(=O)C(C)(C)C3=C(O)C(=O)[C@]21C
InChI Identifier
InChI=1S/C26H30O8/c1-12-11-13-23(4)10-9-14(27)22(2,3)16(23)15(28)18(29)25(13,6)17-19(30)34-26(7,21(32)33-8)20(31)24(12,17)5/h11,17,28H,1,9-10H2,2-8H3/t17-,23-,24+,25-,26-/m0/s1
InChI KeyKHTDLEZHJSFANO-UTZZIKNXSA-N