Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 15:32:10 UTC
Update Date2025-10-07 16:07:36 UTC
Metabolite IDMMDBc0025822
Metabolite Identification
Common NameStagonosporyne G
DescriptionStagonosporyne G is a polyketide, a chemical class characterized by its complex structure formed through the condensation of acetyl and malonyl units. Its chemical structure features a series of carbon chains and functional groups that contribute to its biological activity. Stagonosporyne G is involved in various biochemical pathways, particularly in the context of herbicidal activity, where it has been shown to exhibit significant effects against certain plant species. The compound's mechanism may involve the disruption of metabolic processes in target organisms, leading to herbicidal effects. In a study evaluating multiple compounds for their herbicidal properties, stagonosporyne G was noted for displaying the most significant herbicidal activity, highlighting its potential utility in agricultural applications (PMID:31302342 ). This indicates that Stagonosporyne G may play a role in the development of natural herbicides, contributing to the exploration of environmentally friendly alternatives in pest management strategies.
Structure
SynonymsNot Available
Molecular FormulaC11H14O3
Average Mass194.23
Monoisotopic Mass194.094294311
IUPAC Name(1S,2S,3R,4S)-3-(3-methylbut-3-en-1-yn-1-yl)cyclohex-5-ene-1,2,4-triol
Traditional Name(1S,2S,3R,4S)-3-(3-methylbut-3-en-1-yn-1-yl)cyclohex-5-ene-1,2,4-triol
CAS Registry NumberNot Available
SMILES
[H][C@]1(O)C=C[C@]([H])(O)[C@@]([H])(C#CC(C)=C)[C@]1([H])O
InChI Identifier
InChI=1S/C11H14O3/c1-7(2)3-4-8-9(12)5-6-10(13)11(8)14/h5-6,8-14H,1H2,2H3/t8-,9+,10+,11+/m1/s1
InChI KeyZPYFIPQZEARZFJ-RCWTZXSCSA-N