Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 15:56:21 UTC
Update Date2025-10-07 16:07:38 UTC
Metabolite IDMMDBc0026266
Metabolite Identification
Common NameIndolepyrazine A
DescriptionIndolepyrazine A is a novel alkaloid belonging to the chemical class of indole-pyrazine-oxindole compounds. Its unique chemical structure features a fused indole and pyrazine ring system, which is further modified by an oxindole moiety, making it the first example of such a complex alkaloid (PMID:30717135 ). This intricate arrangement of heterocycles contributes to its potential bioactivity, as it may interact with various biological pathways. Indolepyrazine A has been implicated in modulating signaling pathways related to neurotransmission and may influence cellular processes such as apoptosis and differentiation. The presence of the indole and pyrazine rings suggests that it could engage in π-π stacking interactions with biological macromolecules, potentially affecting enzyme activities or receptor binding. As research continues, understanding the chemical properties and biological pathways associated with Indolepyrazine A could provide insights into its role in natural products and its potential therapeutic applications.
Structure
SynonymsNot Available
Molecular FormulaC22H18N4O2
Average Mass370.412
Monoisotopic Mass370.142975836
IUPAC Name(3S)-3-({6-[(1H-indol-3-yl)methyl]pyrazin-2-yl}methyl)-3H-indole-2,3-diol
Traditional Name(3S)-3-{[6-(1H-indol-3-ylmethyl)pyrazin-2-yl]methyl}indole-2,3-diol
CAS Registry NumberNot Available
SMILES
OC1=NC2=CC=CC=C2[C@@]1(O)CC1=CN=CC(CC2=CNC3=CC=CC=C23)=N1
InChI Identifier
InChI=1S/C22H18N4O2/c27-21-22(28,18-6-2-4-8-20(18)26-21)10-16-13-23-12-15(25-16)9-14-11-24-19-7-3-1-5-17(14)19/h1-8,11-13,24,28H,9-10H2,(H,26,27)/t22-/m0/s1
InChI KeyDZHDNSKQSGLWTF-QFIPXVFZSA-N