Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 15:57:29 UTC
Update Date2025-10-07 16:07:39 UTC
Metabolite IDMMDBc0026291
Metabolite Identification
Common Name4-hydroxysclerodin
Description4-hydroxysclerodin is a secondary metabolite belonging to the class of phenolic compounds. Its chemical structure features a hydroxyl group attached to a sclerodin backbone, which contributes to its biological activities. This compound is involved in various biochemical pathways, including those related to anti-angiogenesis and anti-inflammatory responses. Specifically, studies have shown that 4-hydroxysclerodin, along with other related compounds, exhibits moderate anti-angiogenetic and anti-inflammatory activities, indicating its potential role in regulating vascular growth and inflammation (PMID:30889916 ). The presence of the hydroxyl group in its structure may enhance its reactivity and interaction with biological targets, thereby influencing metabolic pathways. Further investigation into its synthesis and the specific mechanisms of action could provide insights into its potential applications in therapeutic contexts.
Structure
SynonymsNot Available
Molecular FormulaC18H16O7
Average Mass344.319
Monoisotopic Mass344.089602855
IUPAC Name(12S,14S)-6,14-dihydroxy-8,12,13,13-tetramethyl-3,11-dioxatetracyclo[7.6.1.0^{5,16}.0^{10,14}]hexadeca-1(16),5,7,9-tetraene-2,4,15-trione
Traditional Name(12S,14S)-6,14-dihydroxy-8,12,13,13-tetramethyl-3,11-dioxatetracyclo[7.6.1.0^{5,16}.0^{10,14}]hexadeca-1(16),5,7,9-tetraene-2,4,15-trione
CAS Registry NumberNot Available
SMILES
[H][C@@]1(C)OC2=C3C(C)=CC(O)=C4C(=O)OC(=O)C(C(=O)[C@]2(O)C1(C)C)=C34
InChI Identifier
InChI=1S/C18H16O7/c1-6-5-8(19)10-11-9(6)14-18(23,17(3,4)7(2)24-14)13(20)12(11)16(22)25-15(10)21/h5,7,19,23H,1-4H3/t7-,18+/m0/s1
InChI KeyMALPURJFNKAUEM-ULCDLSAGSA-N