Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 16:12:46 UTC
Update Date2025-10-07 16:07:41 UTC
Metabolite IDMMDBc0026562
Metabolite Identification
Common NameNiduterpenoid B
DescriptionNiduterpenoid B is a hexacyclic sesterterpenoid, characterized by its complex chemical structure that includes five cyclopentane rings and one cyclopropane ring, along with 13 contiguous stereocenters, four of which are all-carbon quaternary centers. This intricate polycyclic network not only highlights the chemical diversity found within terpenoids but also underscores the challenges associated with its total synthesis, as demonstrated in recent research (PMID:39235150 ). Niduterpenoid B acts as a naturally occurring estrogen receptor alpha (ERα) inhibitor, indicating its involvement in pathways related to hormonal signaling and potentially influencing various physiological processes. The total synthesis of niduterpenoid B was achieved through a novel structural reorganization strategy, showcasing innovative approaches in synthetic chemistry that can mimic the complexity of naturally occurring metabolites (PMID:39235150 ). This compound exemplifies the intersection of organic chemistry and biological activity, providing insights into the structural intricacies and potential applications of terpenoids in medicinal chemistry.
Structure
SynonymsNot Available
Molecular FormulaC25H40O4
Average Mass404.591
Monoisotopic Mass404.292659768
IUPAC Name(1S,2S,5S,8S,9S,10S,11S,12R,13S,14S,16R,17S)-16-(2-hydroxypropan-2-yl)-5,9,10,13-tetramethylhexacyclo[9.7.0.0^{2,6}.0^{2,9}.0^{12,17}.0^{13,17}]octadecane-5,8,14-triol
Traditional Name(1S,2S,5S,8S,9S,10S,11S,12R,13S,14S,16R,17S)-16-(2-hydroxypropan-2-yl)-5,9,10,13-tetramethylhexacyclo[9.7.0.0^{2,6}.0^{2,9}.0^{12,17}.0^{13,17}]octadecane-5,8,14-triol
CAS Registry NumberNot Available
SMILES
[H][C@@]12[C@@]3([H])[C@]([H])(C)[C@]4(C)[C@@]([H])(O)CC5([H])[C@@](C)(O)CC[C@@]45[C@@]3([H])C[C@@]11[C@@]([H])(C[C@]([H])(O)[C@@]21C)C(C)(C)O
InChI Identifier
InChI=1S/C25H40O4/c1-12-18-13(24-8-7-21(4,29)15(24)10-16(26)22(12,24)5)11-25-14(20(2,3)28)9-17(27)23(25,6)19(18)25/h12-19,26-29H,7-11H2,1-6H3/t12-,13-,14-,15?,16-,17-,18-,19-,21-,22+,23-,24-,25+/m0/s1
InChI KeyPTGRSEKFBBYBMB-NJHNOLDWSA-N