Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 16:13:07 UTC
Update Date2025-10-07 16:07:41 UTC
Metabolite IDMMDBc0026568
Metabolite Identification
Common NameFumihopaside A
DescriptionFumihopaside A is a rare fungal hopane-type triterpenoid glycoside identified in Aspergillus fumigatus. Its chemical structure features a triterpenoid backbone characteristic of hopanoids, which are known for their complex ring systems and functional groups that contribute to their biological activities. The identification of fumihopaside A was achieved through genome mining coupled with HPLC-MS/MS techniques, highlighting its unique biosynthetic origin (PMID:30977375 ). In terms of biological pathways, bioassays have indicated that fumihopaside A plays important roles in protecting A. fumigatus, suggesting its involvement in the organism's defense mechanisms or stress responses (PMID:30977375 ). The specific pathways remain to be fully elucidated, but the compound's triterpenoid nature suggests potential interactions with cellular membranes or signaling pathways, which could be critical for the survival and adaptability of the fungus in various environments. Overall, fumihopaside A exemplifies the intricate chemistry and biological relevance of natural products derived from fungi.
Structure
SynonymsNot Available
Molecular FormulaC36H60O10
Average Mass652.866
Monoisotopic Mass652.418648132
IUPAC Name(2S)-2-hydroxy-2-[(1R,2R,5S,6S,9S,10R,13R,14R,17S,18S,19R)-17-hydroxy-1,2,9,14,18-pentamethyl-18-({[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)pentacyclo[11.8.0.0^{2,10}.0^{5,9}.0^{14,19}]henicosan-6-yl]propanoic acid
Traditional Name(2S)-2-hydroxy-2-[(1R,2R,5S,6S,9S,10R,13R,14R,17S,18S,19R)-17-hydroxy-1,2,9,14,18-pentamethyl-18-({[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)pentacyclo[11.8.0.0^{2,10}.0^{5,9}.0^{14,19}]henicosan-6-yl]propanoic acid
CAS Registry NumberNot Available
SMILES
[H][C@@]1(CC[C@@]2(C)[C@@]1([H])CC[C@]1(C)[C@]2([H])CC[C@]2([H])[C@@]3(C)CC[C@]([H])(O)[C@](C)(CO[C@@]4([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@@]4([H])O)[C@]3([H])CC[C@@]12C)[C@](C)(O)C(O)=O
InChI Identifier
InChI=1S/C36H60O10/c1-31-13-9-20(36(6,44)30(42)43)19(31)10-15-34(4)23(31)7-8-24-32(2)14-12-25(38)33(3,22(32)11-16-35(24,34)5)18-45-29-28(41)27(40)26(39)21(17-37)46-29/h19-29,37-41,44H,7-18H2,1-6H3,(H,42,43)/t19-,20-,21+,22+,23+,24+,25-,26+,27-,28+,29-,31-,32-,33+,34+,35+,36-/m0/s1
InChI KeyBSLRSZZCUIZWND-YDEHQZECSA-N