Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 16:16:28 UTC
Update Date2025-10-07 16:07:41 UTC
Metabolite IDMMDBc0026628
Metabolite Identification
Common NameCoprinoferrin
DescriptionCoprinoferrin is a siderophore belonging to the chemical class of acylated tripeptide hydroxamates. It is characterized by its unique chemical structure, which features tandem aligned N5-hexanoyl-N5-hydroxy-L-ornithine with modifications including N-acetyl and C-carboxamide groups. Originally isolated from a genetically engineered strain (ΔlaeA) of the mushroom fungus Coprinopsis cinerea, coprinoferrin plays a significant role in iron acquisition, a critical process for various biological pathways. The knockout of the laeA gene in C. cinerea led to an unexpected upregulation of coprinoferrin biosynthesis, highlighting its importance in fungal cell development (PMID:31496254 ). Additionally, disruption of the nonribosomal peptide synthetase-encoding gene cpf1, which is essential for coprinoferrin production, resulted in growth defects and impaired fruiting body formation, further underscoring the compound's complex involvement in fungal physiology (PMID:31496254 ). The synthesis and biological evaluation of coprinoferrin have been documented, emphasizing its potential as a vital metabolite in the fungal kingdom (PMID:38175167 ).
Structure
SynonymsNot Available
Molecular FormulaC35H65N7O10
Average Mass743.944
Monoisotopic Mass743.479291321
IUPAC Name(2S)-N-[(1S)-1-{[(1S)-1-(C-hydroxycarbonimidoyl)-4-(N-hydroxyhexanamido)butyl]-C-hydroxycarbonimidoyl}-4-(N-hydroxyhexanamido)butyl]-2-[(1-hydroxyethylidene)amino]-5-(N-hydroxyhexanamido)pentanimidic acid
Traditional Name(2S)-N-[(1S)-1-{[(1S)-1-(C-hydroxycarbonimidoyl)-4-(N-hydroxyhexanamido)butyl]-C-hydroxycarbonimidoyl}-4-(N-hydroxyhexanamido)butyl]-2-[(1-hydroxyethylidene)amino]-5-(N-hydroxyhexanamido)pentanimidic acid
CAS Registry NumberNot Available
SMILES
[H][C@@](CCCN(O)C(=O)CCCCC)(N=C(O)[C@]([H])(CCCN(O)C(=O)CCCCC)N=C(O)[C@]([H])(CCCN(O)C(=O)CCCCC)N=C(C)O)C(O)=N
InChI Identifier
InChI=1S/C35H65N7O10/c1-5-8-11-20-30(44)40(50)23-14-17-27(33(36)47)38-35(49)29(19-16-25-42(52)32(46)22-13-10-7-3)39-34(48)28(37-26(4)43)18-15-24-41(51)31(45)21-12-9-6-2/h27-29,50-52H,5-25H2,1-4H3,(H2,36,47)(H,37,43)(H,38,49)(H,39,48)/t27-,28-,29-/m0/s1
InChI KeyDALRSDAVVXJVPY-AWCRTANDSA-N