Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 16:22:46 UTC
Update Date2025-10-07 16:07:41 UTC
Metabolite IDMMDBc0026718
Metabolite Identification
Common NameDahliane G
DescriptionDahliane G is a flavonoid, a class of compounds known for their diverse biological activities and potential therapeutic effects. Its chemical structure features a flavone backbone, characterized by a benzopyran ring system with hydroxyl substitutions, which contribute to its reactivity and interaction with biological targets. In the context of cancer biology, Dahliane G has been shown to significantly enhance the efficacy of doxorubicin, a commonly used chemotherapeutic agent, by exhibiting an 80-fold potentiation effect on the sensitization of doxorubicin at a concentration of 15 μM. This effect was observed in doxorubicin-resistant human breast cancer cells (MCF-7/DOX), indicating that Dahliane G may play a role in reversing drug resistance pathways in cancer treatment (PMID:30659876 ). Its ability to modulate drug response highlights its potential as a co-therapeutic agent in enhancing the effectiveness of existing chemotherapy regimens. Further studies on the detailed mechanisms by which Dahliane G interacts with cellular pathways could provide insights into its utility in oncological therapies.
Structure
SynonymsNot Available
Molecular FormulaC22H32O5
Average Mass376.493
Monoisotopic Mass376.22497413
IUPAC Name[(1R,2S,3S,8aR,10aR)-2,3-dihydroxy-8a,10a-dimethyl-6-oxo-1-(propan-2-yl)-1H,2H,3H,6H,7H,8H,8aH,9H,10H,10aH-cyclohexa[f]azulen-5-yl]methyl acetate
Traditional Name[(1R,2S,3S,8aR,10aR)-2,3-dihydroxy-1-isopropyl-8a,10a-dimethyl-6-oxo-1H,2H,3H,7H,8H,9H,10H-cyclohexa[f]azulen-5-yl]methyl acetate
CAS Registry NumberNot Available
SMILES
[H][C@]1(O)C2=CC3=C(COC(C)=O)C(=O)CC[C@@]3(C)CC[C@]2(C)[C@@]([H])(C(C)C)[C@]1([H])O
InChI Identifier
InChI=1S/C22H32O5/c1-12(2)18-20(26)19(25)16-10-15-14(11-27-13(3)23)17(24)6-7-21(15,4)8-9-22(16,18)5/h10,12,18-20,25-26H,6-9,11H2,1-5H3/t18-,19-,20-,21-,22-/m0/s1
InChI KeyVLKWNDNCESOJPC-YFNVTMOMSA-N