Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 16:58:54 UTC
Update Date2025-10-07 16:07:42 UTC
Metabolite IDMMDBc0027261
Metabolite Identification
Common NameMooreaside A
DescriptionMooreaside A is a cerebroside, a class of glycosphingolipids characterized by a sugar moiety linked to a ceramide backbone. Its chemical structure features a long-chain fatty acid attached to a sphingosine base, which is further glycosylated, contributing to its unique properties. The compound was isolated from the organic extract of the Red Sea cyanobacterium, highlighting its potential as a novel metabolite with distinct biochemical pathways. Cerebrosides like mooreaside A are involved in various cellular processes, including cell membrane structure and signaling, as they can influence membrane fluidity and protein interactions. Additionally, they play roles in neurobiology and immune responses, serving as recognition sites for specific proteins and pathogens. The identification of mooreaside A alongside other nucleoside derivatives in the same study suggests a complex interplay of metabolites that may contribute to the organism's adaptation and survival in its marine environment (PMID:27005610 ).
Structure
SynonymsNot Available
Molecular FormulaC48H93NO8
Average Mass812.271
Monoisotopic Mass811.690118959
IUPAC NameN-[(2S,3R,5E)-3-hydroxy-1-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}heptadec-5-en-2-yl]pentacosanimidic acid
Traditional NameN-[(2S,3R,5E)-3-hydroxy-1-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}heptadec-5-en-2-yl]pentacosanimidic acid
CAS Registry NumberNot Available
SMILES
[H]\C(CCCCCCCCCCC)=C(\[H])C[C@@]([H])(O)[C@]([H])(CO[C@]1([H])O[C@]([H])(CO)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])O)N=C(O)CCCCCCCCCCCCCCCCCCCCCCCC
InChI Identifier
InChI=1S/C48H93NO8/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-28-30-32-34-36-38-44(52)49-41(40-56-48-47(55)46(54)45(53)43(39-50)57-48)42(51)37-35-33-31-29-27-16-14-12-10-8-6-4-2/h33,35,41-43,45-48,50-51,53-55H,3-32,34,36-40H2,1-2H3,(H,49,52)/b35-33+/t41-,42+,43+,45+,46-,47+,48+/m0/s1
InChI KeyDJXVTSAPDGAYAX-JPUVSGHGSA-N