Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 17:14:30 UTC
Update Date2025-10-07 16:07:43 UTC
Metabolite IDMMDBc0027524
Metabolite Identification
Common NameAsperteretal E
DescriptionAsperteretal E is a butenolide derivative belonging to the chemical class of lactones, specifically characterized by its rare 2-benzyl-3-phenyl substituted lactone core. The compound was isolated from the fungus Aspergillus terreus, which was derived from the marine sponge Phakellia fusca, highlighting its unique biosynthetic origin (PMID:29295795 ). The chemical structure of Asperteretal E features a cyclic lactone framework that may contribute to its potential bioactivity. In terms of biochemical pathways, butenolides like Asperteretal E can be involved in various metabolic processes, including interactions with cellular signaling pathways and potential roles in secondary metabolite production. While the specific biological significance of Asperteretal E remains to be fully elucidated, its structural characteristics suggest it could play a role in the complex interplay of fungal metabolism and host interactions, possibly influencing ecological dynamics or exhibiting pharmacological properties. Further research is needed to explore the full range of activities and mechanisms associated with Asperteretal E in both fungal biology and potential therapeutic applications.
Structure
SynonymsNot Available
Molecular FormulaC22H22O5
Average Mass366.413
Monoisotopic Mass366.146723808
IUPAC Name3-[(2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-6-yl)methyl]-5-hydroxy-4-(4-hydroxyphenyl)-2,5-dihydrofuran-2-one
Traditional Name3-[(2,2-dimethyl-3,4-dihydro-1-benzopyran-6-yl)methyl]-5-hydroxy-4-(4-hydroxyphenyl)-5H-furan-2-one
CAS Registry NumberNot Available
SMILES
CC1(C)CCC2=C(O1)C=CC(CC1=C(C(O)OC1=O)C1=CC=C(O)C=C1)=C2
InChI Identifier
InChI=1S/C22H22O5/c1-22(2)10-9-15-11-13(3-8-18(15)27-22)12-17-19(21(25)26-20(17)24)14-4-6-16(23)7-5-14/h3-8,11,21,23,25H,9-10,12H2,1-2H3
InChI KeyQCPXFZKWSHOJCI-UHFFFAOYSA-N