Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 17:39:18 UTC
Update Date2025-10-07 16:07:48 UTC
Metabolite IDMMDBc0028030
Metabolite Identification
Common NameAspersteroid A
DescriptionAspersteroid A is a highly rearranged 1(10 → 6)-abeo-18,22-cyclosterol, belonging to the chemical class of cyclosterols. Its unique chemical structure features a complex arrangement that differentiates it from other sterols, characterized by the rearrangement of the steroid backbone. Aspersteroid A was isolated from the culture extract of Aspergillus ustus NRRL 275, alongside two new 18,22-cyclosterols, highlighting its significance within the metabolic pathways of this fungal species (PMID:34881899 ). The presence of such metabolites suggests involvement in various biosynthetic processes, potentially influencing the organism's growth and adaptation mechanisms. The structural complexity of Aspersteroid A may also indicate its role in interactions with cellular membranes or signaling pathways, although specific biological functions remain to be fully elucidated. Overall, the chemistry of Aspersteroid A presents intriguing possibilities for further exploration in both natural product chemistry and fungal metabolism.
Structure
SynonymsNot Available
Molecular FormulaC28H36O4
Average Mass436.592
Monoisotopic Mass436.261359639
IUPAC Name(4E,6R)-6-[(1R,2R,14R,15R)-2,15-dimethyl-6,9-dioxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-4,7,10-trien-14-yl]-2,3-dimethylhept-4-enoic acid
Traditional Name(4E,6R)-6-[(1R,2R,14R,15R)-2,15-dimethyl-6,9-dioxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-4,7,10-trien-14-yl]-2,3-dimethylhept-4-enoic acid
CAS Registry NumberNot Available
SMILES
[H]\C(=C(\[H])[C@@]([H])(C)[C@@]1([H])CCC2=C3C(=O)C=C4C(=O)C=CC[C@]4(C)[C@@]3([H])CC[C@]12C)C([H])(C)C([H])(C)C(O)=O
InChI Identifier
InChI=1S/C28H36O4/c1-16(18(3)26(31)32)8-9-17(2)19-10-11-20-25-21(12-14-28(19,20)5)27(4)13-6-7-23(29)22(27)15-24(25)30/h6-9,15-19,21H,10-14H2,1-5H3,(H,31,32)/b9-8+/t16?,17-,18?,19-,21+,27-,28-/m1/s1
InChI KeyLENSREMNGPQVHG-UZDJOFILSA-N