Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 17:41:09 UTC
Update Date2025-10-07 16:07:48 UTC
Metabolite IDMMDBc0028060
Metabolite Identification
Common Name5S-hydroxynorvaline-S-Ile
Description5S-hydroxynorvaline-S-Ile is a diketopiperazine alkaloid, a chemical class characterized by a cyclic structure formed from two amino acids linked by peptide bonds. Its chemical structure features a hydroxyl group at the 5th position of the norvaline moiety, which contributes to its unique properties. This compound has been isolated from the Chinese mangrove endophytic fungus Penicillium sp., alongside other metabolites, suggesting a diverse biosynthetic capability within this organism (PMID:29860997 ). In terms of biological pathways, diketopiperazines like 5S-hydroxynorvaline-S-Ile are often involved in various metabolic processes, including those related to secondary metabolite production, which can play roles in ecological interactions and potential pharmacological activities. The specific pathways of 5S-hydroxynorvaline-S-Ile are not extensively detailed in literature, but diketopiperazines generally contribute to the biosynthesis of bioactive compounds, potentially influencing microbial interactions and plant defense mechanisms.
Structure
SynonymsNot Available
Molecular FormulaC11H20N2O3
Average Mass228.292
Monoisotopic Mass228.147392512
IUPAC Name(3S,6S)-3-[(2S)-butan-2-yl]-6-(3-hydroxypropyl)-3,6-dihydropyrazine-2,5-diol
Traditional Name(3S,6S)-3-[(2S)-butan-2-yl]-6-(3-hydroxypropyl)-3,6-dihydropyrazine-2,5-diol
CAS Registry NumberNot Available
SMILES
[H][C@](C)(CC)[C@]1([H])N=C(O)[C@]([H])(CCCO)N=C1O
InChI Identifier
InChI=1S/C11H20N2O3/c1-3-7(2)9-11(16)12-8(5-4-6-14)10(15)13-9/h7-9,14H,3-6H2,1-2H3,(H,12,16)(H,13,15)/t7-,8-,9-/m0/s1
InChI KeyPWIAWDVLQXARBI-CIUDSAMLSA-N