Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 17:51:01 UTC
Update Date2025-10-07 16:07:50 UTC
Metabolite IDMMDBc0028216
Metabolite Identification
Common NameFusarielin H
DescriptionFusarielin H is a member of the chemical class of mycotoxins, specifically a metabolite produced by the fungus Fusarium sp. Its chemical structure is characterized by a complex arrangement of carbon, hydrogen, and oxygen atoms, typical of secondary metabolites from fungi. Fusarielin H is involved in various biological pathways, including the production of other mycotoxins such as deoxynivalenol (DON) and zearalenone, where its biosynthesis is regulated by the AreA transcription factor, indicating its role in nutrient response (PMID:24295920 ). Additionally, deletion mutants lacking specific transporters showed increased production of DON and zearalenone but reduced levels of fusarielin H, highlighting its interconnected biosynthetic pathway (PMID:28390508 ). Fusarielin H has been detected in infected cereals, with concentrations ranging from 392 to 1865 ng/g, suggesting its production during fungal infection (PMID:23290226 ). Furthermore, it demonstrates significant biological activity, stimulating MCF-7 cell proliferation four-fold at 25 μM, making it the most potent among tested fusarielins (PMID:22982765 ), and exhibiting higher potency against colorectal cancer cell lines compared to other fusarielins (PMID:22252016 ).
Structure
SynonymsNot Available
Molecular FormulaC25H38O3
Average Mass386.576
Monoisotopic Mass386.282095084
IUPAC Name(2S,3S,4E,6E)-7-[(1aR,2R,3S,3aS,7aR,7bS)-2-[(2E)-but-2-en-2-yl]-1a,6-dimethyl-1aH,2H,3H,3aH,4H,7H,7aH,7bH-naphtho[1,2-b]oxiren-3-yl]-2,4-dimethylhepta-4,6-diene-1,3-diol
Traditional Name(2S,3S,4E,6E)-7-[(1aR,2R,3S,3aS,7aR,7bS)-2-[(2E)-but-2-en-2-yl]-1a,6-dimethyl-2H,3H,3aH,4H,7H,7aH,7bH-naphtho[1,2-b]oxiren-3-yl]-2,4-dimethylhepta-4,6-diene-1,3-diol
CAS Registry NumberNot Available
SMILES
[H]C(C)=C(C)[C@@]1([H])[C@@]([H])(C([H])=C([H])C(\[H])=C(/C)[C@@]([H])(O)[C@@]([H])(C)CO)[C@]2([H])CC=C(C)C[C@@]2([H])[C@]2([H])O[C@]12C
InChI Identifier
InChI=1S/C25H38O3/c1-7-16(3)22-20(10-8-9-17(4)23(27)18(5)14-26)19-12-11-15(2)13-21(19)24-25(22,6)28-24/h7-11,18-24,26-27H,12-14H2,1-6H3/b10-8-,16-7+,17-9+/t18-,19-,20-,21+,22-,23+,24-,25+/m0/s1
InChI KeyIFASIJVLMUACLJ-MXOTVBERSA-N