Xenobiotic
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 17:52:20 UTC
Update Date2025-10-07 16:07:50 UTC
Metabolite IDMMDBc0028235
Metabolite Identification
Common NameAspergillic acid
DescriptionAspergillic acid is a hydroxamic acid-containing pyrazinone metabolite belonging to the class of iron-binding compounds. Its chemical structure features a complex arrangement that includes a hydroxamic acid functional group, which is crucial for its metal chelation properties. Aspergillic acid is primarily synthesized in the Aspergillus genus, with the biosynthetic pathway involving the asa gene cluster, which has been shown to be responsible for its production (PMID:37746228 ). In various studies, the upregulation of aspergillic acid has been observed in specific mutant strains, indicating its role in metabolic pathways alongside other metabolites such as aflatoxin and kojic acid (PMID:39452671 ). Additionally, its synthesis is influenced by genetic factors, as demonstrated by the profiling of mutants lacking certain non-ribosomal synthetases (PMID:40262766 ). Aspergillic acid's involvement in metabolic interactions is further highlighted by its varying levels in the presence of bacteria and other environmental factors (PMID:38980562 ). Overall, aspergillic acid serves as an important component in the metabolic landscape of Aspergillus species, contributing to the diversity of secondary metabolites produced by these fungi.
Structure
SynonymsNot Available
Molecular FormulaC12H20N2O2
Average Mass224.304
Monoisotopic Mass224.152477892
IUPAC NameNot Available
Traditional NameNot Available
CAS Registry NumberNot Available
SMILESNot Available
InChI Identifier
InChI=1S/C12H20N2O2/c1-5-9(4)11-7-13-10(6-8(2)3)12(15)14(11)16/h7-9,16H,5-6H2,1-4H3
InChI KeyIUZCDJYHMMWBBE-UHFFFAOYSA-N