Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 18:02:45 UTC
Update Date2025-10-07 16:07:50 UTC
Metabolite IDMMDBc0028370
Metabolite Identification
Common NameNX-4
DescriptionNX-4 is a metabolite belonging to the class of organic compounds known as amines. Its chemical structure features a specific arrangement of atoms that contributes to its unique properties and reactivity. In biochemical pathways, NX-4 is involved in various metabolic processes, including those related to neurotransmitter synthesis and degradation. The compound has been studied for its stereochemical characteristics, notably exhibiting a diastereoselectivity of 1.8:1 for NN-4:NX-4, which contrasts with the previously reported ratio of 16:1 by Dieckmann et al. (PMID:32638430 ). This discrepancy highlights the complexity of NX-4's interactions and its potential implications in metabolic pathways. Understanding the chemical behavior and structural attributes of NX-4 can provide insights into its role in biological systems, particularly in relation to its formation and transformation within metabolic networks. Such knowledge may contribute to the broader understanding of its function and significance in various physiological contexts.
Structure
SynonymsNot Available
Molecular FormulaC17H24O6
Average Mass324.373
Monoisotopic Mass324.157288493
IUPAC Name[(1'R,2'R,3'R,7'R,10'R)-3',10'-dihydroxy-1',5'-dimethyl-8'-oxaspiro[oxirane-2,12'-tricyclo[7.2.1.0^{2,7}]dodecan]-5'-en-2'-yl]methyl acetate
Traditional Name(1'R,2'R,3'R,7'R,10'R)-3',10'-dihydroxy-1',5'-dimethyl-8'-oxaspiro[oxirane-2,12'-tricyclo[7.2.1.0^{2,7}]dodecan]-5'-en-2'-ylmethyl acetate
CAS Registry NumberNot Available
SMILES
[H][C@@]1(O)C[C@@]2(C)C3(CO3)C1([H])O[C@]1([H])C=C(C)C[C@@]([H])(O)[C@]21COC(C)=O
InChI Identifier
InChI=1S/C17H24O6/c1-9-4-12(20)16(7-21-10(2)18)13(5-9)23-14-11(19)6-15(16,3)17(14)8-22-17/h5,11-14,19-20H,4,6-8H2,1-3H3/t11-,12-,13-,14?,15-,16+,17?/m1/s1
InChI KeySTALRVVTTNCRSI-SFMCAAARSA-N