Microbial
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-11-19 04:38:08 UTC
Update Date2025-10-07 16:07:57 UTC
Metabolite IDMMDBc0033184
Metabolite Identification
Common Namedolichyl phosphate
DescriptionDolichyl phosphate is a polyisoprenoid lipid that belongs to the class of essential lipid carriers involved in protein glycosylation. Its chemical structure consists of a long hydrophobic chain formed by multiple isoprene units, which is esterified to a phosphate group. Dolichyl phosphate plays a crucial role in the biosynthesis of glycoproteins by serving as a carrier for oligosaccharide chains during the glycosylation process, facilitating the transfer of sugar moieties to nascent polypeptides. The biosynthesis of polyprenyl/dolichyl phosphate occurs across all domains of life, highlighting its fundamental importance in cellular processes (PMID:40847593 ). Dolichyl phosphates are ubiquitous lipids found in nearly all eukaryotic membranes, underscoring their widespread biological relevance (PMID:38023789 ). Additionally, de novo synthesis of dolichol and dolichyl phosphate is essential for proper protein glycosylation, a critical post-translational modification that affects protein folding, stability, and function (PMID:37440071 ). Recent advancements have also enabled rapid quantification of dolichyl phosphates in cell cultures, utilizing techniques such as TMSD methylation combined with LC-MS analysis (PMID:38023789 ).
Structure
Synonyms
ValueSource
Dolichyl phosphoric acidGenerator
Molecular FormulaC100H165O4P
Average Mass1462.3515
Monoisotopic Mass1461.24455028
IUPAC Name{[(6E,10E,14E,18E,22Z,26E,30E,34E,38E,42E,46E,50E,54E,58Z,62E,66E,70E,74E)-3,7,11,15,19,23,27,31,35,39,43,47,51,55,59,63,67,71,75,79-icosamethyloctaconta-6,10,14,18,22,26,30,34,38,42,46,50,54,58,62,66,70,74,78-nonadecaen-1-yl]oxy}phosphonic acid
Traditional Name[(6E,10E,14E,18E,22Z,26E,30E,34E,38E,42E,46E,50E,54E,58Z,62E,66E,70E,74E)-3,7,11,15,19,23,27,31,35,39,43,47,51,55,59,63,67,71,75,79-icosamethyloctaconta-6,10,14,18,22,26,30,34,38,42,46,50,54,58,62,66,70,74,78-nonadecaen-1-yl]oxyphosphonic acid
CAS Registry Number12698-55-4
SMILES
CC(CCOP(O)(O)=O)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C
InChI Identifier
InChI=1S/C100H165O4P/c1-81(2)41-22-42-82(3)43-23-44-83(4)45-24-46-84(5)47-25-48-85(6)49-26-50-86(7)51-27-52-87(8)53-28-54-88(9)55-29-56-89(10)57-30-58-90(11)59-31-60-91(12)61-32-62-92(13)63-33-64-93(14)65-34-66-94(15)67-35-68-95(16)69-36-70-96(17)71-37-72-97(18)73-38-74-98(19)75-39-76-99(20)77-40-78-100(21)79-80-104-105(101,102)103/h41,43,45,47,49,51,53,55,57,59,61,63,65,67,69,71,73,75,77,100H,22-40,42,44,46,48,50,52,54,56,58,60,62,64,66,68,70,72,74,76,78-80H2,1-21H3,(H2,101,102,103)/b82-43+,83-45+,84-47+,85-49+,86-51-,87-53+,88-55+,89-57+,90-59+,91-61+,92-63+,93-65+,94-67+,95-69-,96-71+,97-73+,98-75+,99-77+
InChI KeyANYZAZFGBISMDO-OYHKHEHLSA-N